3,7-Dimethyl-10-propan-2-ylcyclodec-2-ene-1,6-dione
| Internal ID | fa7f9d2e-fb13-4c57-ace8-11a807b59f05 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Germacrane sesquiterpenoids |
| IUPAC Name | 3,7-dimethyl-10-propan-2-ylcyclodec-2-ene-1,6-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H24O2/c1-10(2)13-7-6-12(4)14(16)8-5-11(3)9-15(13)17/h9-10,12-13H,5-8H2,1-4H3 |
| InChI Key | XAGZDWNJBFVXAE-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.177630004 g/mol |
| Topological Polar Surface Area (TPSA) | 34.10 Ų |
| XlogP | 2.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.49% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.48% | 95.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.03% | 97.25% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 89.67% | 96.38% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 89.48% | 86.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.34% | 90.71% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.37% | 93.40% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.67% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.91% | 96.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.13% | 95.89% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.49% | 96.47% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 82.41% | 90.24% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.01% | 99.18% |
| CHEMBL1871 | P10275 | Androgen Receptor | 81.23% | 96.43% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.92% | 91.11% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.36% | 94.80% |
| CHEMBL4072 | P07858 | Cathepsin B | 80.31% | 93.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Porella swartziana |
| PubChem | 162930959 |
| LOTUS | LTS0230559 |
| wikiData | Q105323921 |