3,7-dihydroxy-2-[3-[(3S)-4-hydroxy-3-methylbutyl]-4-methoxyphenyl]-5,6-dimethoxychromen-4-one
Internal ID | 990cec3e-9eca-4436-b5df-f695abdfe610 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones > 3-prenylated flavones |
IUPAC Name | 3,7-dihydroxy-2-[3-[(3S)-4-hydroxy-3-methylbutyl]-4-methoxyphenyl]-5,6-dimethoxychromen-4-one |
SMILES (Canonical) | CC(CCC1=C(C=CC(=C1)C2=C(C(=O)C3=C(O2)C=C(C(=C3OC)OC)O)O)OC)CO |
SMILES (Isomeric) | C[C@@H](CCC1=C(C=CC(=C1)C2=C(C(=O)C3=C(O2)C=C(C(=C3OC)OC)O)O)OC)CO |
InChI | InChI=1S/C23H26O8/c1-12(11-24)5-6-13-9-14(7-8-16(13)28-2)21-20(27)19(26)18-17(31-21)10-15(25)22(29-3)23(18)30-4/h7-10,12,24-25,27H,5-6,11H2,1-4H3/t12-/m0/s1 |
InChI Key | WLKFOJZKYWLYJJ-LBPRGKRZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H26O8 |
Molecular Weight | 430.40 g/mol |
Exact Mass | 430.16276778 g/mol |
Topological Polar Surface Area (TPSA) | 115.00 Ų |
XlogP | 3.30 |
There are no found synonyms. |
![2D Structure of 3,7-dihydroxy-2-[3-[(3S)-4-hydroxy-3-methylbutyl]-4-methoxyphenyl]-5,6-dimethoxychromen-4-one 2D Structure of 3,7-dihydroxy-2-[3-[(3S)-4-hydroxy-3-methylbutyl]-4-methoxyphenyl]-5,6-dimethoxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/37-dihydroxy-2-3-3s-4-hydroxy-3-methylbutyl-4-methoxyphenyl-56-dimethoxychromen-4-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.38% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.45% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.76% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.01% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.61% | 99.15% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.83% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.50% | 96.09% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 90.01% | 90.20% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.16% | 99.17% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.35% | 94.75% |
CHEMBL1907 | P15144 | Aminopeptidase N | 88.19% | 93.31% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.08% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.07% | 96.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.59% | 90.71% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.51% | 93.99% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.54% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 82.59% | 90.71% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.50% | 86.92% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.41% | 94.73% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.06% | 92.62% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.55% | 85.14% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.14% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Duranta erecta |
PubChem | 162994542 |
LOTUS | LTS0116284 |
wikiData | Q104667397 |