(3-Hydroxy-6,9,12-trimethyl-11-oxo-3-propan-2-yl-8-tetracyclo[7.5.0.02,6.012,14]tetradecanyl) acetate
| Internal ID | 74bd884a-1840-400b-a523-c8333463c7c5 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | (3-hydroxy-6,9,12-trimethyl-11-oxo-3-propan-2-yl-8-tetracyclo[7.5.0.02,6.012,14]tetradecanyl) acetate |
| SMILES (Canonical) | CC(C)C1(CCC2(C1C3C4CC4(C(=O)CC3(C(C2)OC(=O)C)C)C)C)O |
| SMILES (Isomeric) | CC(C)C1(CCC2(C1C3C4CC4(C(=O)CC3(C(C2)OC(=O)C)C)C)C)O |
| InChI | InChI=1S/C22H34O4/c1-12(2)22(25)8-7-19(4)11-16(26-13(3)23)21(6)10-15(24)20(5)9-14(20)17(21)18(19)22/h12,14,16-18,25H,7-11H2,1-6H3 |
| InChI Key | UHZDNNFXAPCZGB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.24570956 g/mol |
| Topological Polar Surface Area (TPSA) | 63.60 Ų |
| XlogP | 3.40 |
| There are no found synonyms. |
![2D Structure of (3-Hydroxy-6,9,12-trimethyl-11-oxo-3-propan-2-yl-8-tetracyclo[7.5.0.02,6.012,14]tetradecanyl) acetate](https://plantaedb.com/storage/docs/compounds/2023/11/36f6d160-8783-11ee-a699-ef121a5e7cf6.jpg "2D Structure of (3-Hydroxy-6,9,12-trimethyl-11-oxo-3-propan-2-yl-8-tetracyclo[7.5.0.02,6.012,14]tetradecanyl) acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.91% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.17% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.58% | 97.25% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.75% | 94.75% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.38% | 82.69% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.73% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.37% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.97% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.34% | 99.23% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 85.14% | 91.24% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 84.37% | 95.71% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.62% | 91.19% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.54% | 93.03% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.91% | 95.56% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 81.81% | 98.03% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.25% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Fossombronia alaskana |
| PubChem | 163023748 |
| LOTUS | LTS0150430 |
| wikiData | Q105273188 |