(5S,9R,10S,11R,13R,14R,15S,17R)-11,15-dihydroxy-17-[(2S)-6-hydroxy-6-methyl-5-oxoheptan-2-yl]-10,13-dimethyl-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one
| Internal ID | d6e67433-3d4f-46ef-9235-339674a8761f |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Bile acids, alcohols and derivatives > Hydroxy bile acids, alcohols and derivatives > Trihydroxy bile acids, alcohols and derivatives |
| IUPAC Name | (5S,9R,10S,11R,13R,14R,15S,17R)-11,15-dihydroxy-17-[(2S)-6-hydroxy-6-methyl-5-oxoheptan-2-yl]-10,13-dimethyl-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES (Canonical) | CC(CCC(=O)C(C)(C)O)C1CC(C2C1(CC(C3C2=CCC4C3(CCC(=O)C4)C)O)C)O |
| SMILES (Isomeric) | C[C@@H](CCC(=O)C(C)(C)O)[C@H]1C[C@@H]([C@@H]2[C@@]1(C[C@H]([C@H]3C2=CC[C@@H]4[C@@]3(CCC(=O)C4)C)O)C)O |
| InChI | InChI=1S/C27H42O5/c1-15(6-9-22(31)25(2,3)32)19-13-20(29)23-18-8-7-16-12-17(28)10-11-26(16,4)24(18)21(30)14-27(19,23)5/h8,15-16,19-21,23-24,29-30,32H,6-7,9-14H2,1-5H3/t15-,16-,19+,20-,21+,23+,24+,26-,27+/m0/s1 |
| InChI Key | WPISUEJUASQDBP-JWAQVPNSSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C27H42O5 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.30322444 g/mol |
| Topological Polar Surface Area (TPSA) | 94.80 Ų |
| XlogP | 2.20 |
| (5S,9R,10S,11R,13R,14R,15S,17R)-11,15-dihydroxy-17-[(2S)-6-hydroxy-6-methyl-5-oxoheptan-2-yl]-10,13-dimethyl-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.90% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.64% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.52% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.76% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.45% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.01% | 97.09% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.08% | 96.61% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.29% | 95.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.86% | 90.71% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 86.31% | 97.79% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.10% | 100.00% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.62% | 93.04% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.15% | 82.69% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.37% | 93.56% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 83.07% | 98.10% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.85% | 97.14% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 81.83% | 98.03% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.77% | 89.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.13% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146683514 |
| LOTUS | LTS0064701 |
| wikiData | Q105026916 |