[(2S,3R,4S,5S)-4,5-diacetyloxy-2-[[(3S,6R,8S,11R,12S,15S,16R,19S,21R)-19-acetyloxy-3,7,7,11,16,20,20-heptamethyl-8-pentacyclo[13.8.0.03,12.06,11.016,21]tricos-1(23)-enyl]oxy]oxan-3-yl] (E)-3-(4-acetyloxyphenyl)prop-2-enoate
| Internal ID | 772501c7-904b-4720-ac6f-d466a4b2517a |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | [(2S,3R,4S,5S)-4,5-diacetyloxy-2-[[(3S,6R,8S,11R,12S,15S,16R,19S,21R)-19-acetyloxy-3,7,7,11,16,20,20-heptamethyl-8-pentacyclo[13.8.0.03,12.06,11.016,21]tricos-1(23)-enyl]oxy]oxan-3-yl] (E)-3-(4-acetyloxyphenyl)prop-2-enoate |
| SMILES (Canonical) | CC(=O)OC1CCC2(C3CCC4C(CCC5C4(CCC(C5(C)C)OC6C(C(C(CO6)OC(=O)C)OC(=O)C)OC(=O)C=CC7=CC=C(C=C7)OC(=O)C)C)(CC3=CCC2C1(C)C)C)C |
| SMILES (Isomeric) | CC(=O)O[C@H]1CC[C@@]2([C@H]3CC[C@H]4[C@@](CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)O[C@H]6[C@@H]([C@H]([C@H](CO6)OC(=O)C)OC(=O)C)OC(=O)/C=C/C7=CC=C(C=C7)OC(=O)C)C)(CC3=CC[C@H]2C1(C)C)C)C |
| InChI | InChI=1S/C52H72O12/c1-30(53)59-36-16-12-34(13-17-36)14-21-44(57)64-46-45(62-33(4)56)38(60-31(2)54)29-58-47(46)63-43-24-27-52(11)40(49(43,7)8)22-25-50(9)28-35-15-19-39-48(5,6)42(61-32(3)55)23-26-51(39,10)37(35)18-20-41(50)52/h12-17,21,37-43,45-47H,18-20,22-29H2,1-11H3/b21-14+/t37-,38-,39-,40-,41-,42-,43-,45-,46+,47-,50-,51+,52-/m0/s1 |
| InChI Key | RYYDWXCXORQFQE-XZUFBIRPSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C52H72O12 |
| Molecular Weight | 889.10 g/mol |
| Exact Mass | 888.50237773 g/mol |
| Topological Polar Surface Area (TPSA) | 150.00 Ų |
| XlogP | 10.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.70% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.44% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.66% | 86.33% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.30% | 90.17% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 92.90% | 83.57% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.57% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.39% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.53% | 94.45% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 91.45% | 85.30% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.93% | 89.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.61% | 95.89% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 88.48% | 97.28% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.81% | 92.62% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.83% | 91.07% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.67% | 94.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.33% | 90.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.21% | 93.00% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.32% | 95.71% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 81.81% | 89.67% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.76% | 99.17% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 81.48% | 92.88% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 81.44% | 85.49% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 81.29% | 95.92% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 80.92% | 85.31% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.05% | 91.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lycopodiella inundata |
| PubChem | 163188346 |
| LOTUS | LTS0223609 |
| wikiData | Q105248218 |