3,6,9-Trimethyl-3,3a,9a,9b-tetrahydroazuleno[4,5-b]furan-2,7-dione
| Internal ID | 700b830c-2f80-49e7-b4a7-4f4640c7d83b |
| Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
| IUPAC Name | 3,6,9-trimethyl-3,3a,9a,9b-tetrahydroazuleno[4,5-b]furan-2,7-dione |
| SMILES (Canonical) | CC1C2C=CC(=C3C(C2OC1=O)C(=CC3=O)C)C |
| SMILES (Isomeric) | CC1C2C=CC(=C3C(C2OC1=O)C(=CC3=O)C)C |
| InChI | InChI=1S/C15H16O3/c1-7-4-5-10-9(3)15(17)18-14(10)13-8(2)6-11(16)12(7)13/h4-6,9-10,13-14H,1-3H3 |
| InChI Key | ZCQUVYYTTJUIOH-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.109944368 g/mol |
| Topological Polar Surface Area (TPSA) | 43.40 Ų |
| XlogP | 1.60 |
| There are no found synonyms. |
![2D Structure of 3,6,9-Trimethyl-3,3a,9a,9b-tetrahydroazuleno[4,5-b]furan-2,7-dione](https://plantaedb.com/storage/docs/compounds/2023/11/369-trimethyl-33a9a9b-tetrahydroazuleno45-bfuran-27-dione.jpg "2D Structure of 3,6,9-Trimethyl-3,3a,9a,9b-tetrahydroazuleno[4,5-b]furan-2,7-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.22% | 95.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.99% | 97.25% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 86.40% | 94.80% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.87% | 85.14% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.93% | 93.65% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 84.80% | 86.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.19% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.21% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.84% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.08% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Seriphidium leucodes |
| PubChem | 162989569 |
| LOTUS | LTS0212498 |
| wikiData | Q105371371 |