(1S,2R,4aS,6aR,6aS,6bR,8aR,10R,11R,12aR,14bS)-11-hydroxy-10-[(Z)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid
Internal ID | f5e3f055-5972-45d8-b41c-d3d53dfa42f9 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1S,2R,4aS,6aR,6aS,6bR,8aR,10R,11R,12aR,14bS)-11-hydroxy-10-[(Z)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid |
SMILES (Canonical) | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CC(C(C5(C)C)OC(=O)C=CC6=CC(=C(C=C6)O)OC)O)C)C)C2C1C)C)C(=O)O |
SMILES (Isomeric) | C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(C[C@H]([C@@H](C5(C)C)OC(=O)/C=C\C6=CC(=C(C=C6)O)OC)O)C)C)[C@@H]2[C@H]1C)C)C(=O)O |
InChI | InChI=1S/C40H56O7/c1-23-15-18-40(35(44)45)20-19-38(6)26(33(40)24(23)2)11-13-31-37(5)22-28(42)34(36(3,4)30(37)16-17-39(31,38)7)47-32(43)14-10-25-9-12-27(41)29(21-25)46-8/h9-12,14,21,23-24,28,30-31,33-34,41-42H,13,15-20,22H2,1-8H3,(H,44,45)/b14-10-/t23-,24+,28-,30+,31-,33+,34+,37+,38-,39-,40+/m1/s1 |
InChI Key | LOYUSEWSBJOCNL-AQHPYVSKSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C40H56O7 |
Molecular Weight | 648.90 g/mol |
Exact Mass | 648.40260412 g/mol |
Topological Polar Surface Area (TPSA) | 113.00 Ų |
XlogP | 8.60 |
There are no found synonyms. |
![2D Structure of (1S,2R,4aS,6aR,6aS,6bR,8aR,10R,11R,12aR,14bS)-11-hydroxy-10-[(Z)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid 2D Structure of (1S,2R,4aS,6aR,6aS,6bR,8aR,10R,11R,12aR,14bS)-11-hydroxy-10-[(Z)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/36482f90-86fd-11ee-8573-a7c7d20d37e2.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.70% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.77% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.21% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.54% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.63% | 94.45% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.85% | 92.94% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.56% | 91.19% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 89.33% | 85.30% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.76% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.06% | 95.89% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.50% | 91.07% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.04% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.00% | 89.00% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 84.77% | 92.98% |
CHEMBL3194 | P02766 | Transthyretin | 84.70% | 90.71% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.53% | 97.14% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.97% | 89.62% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.87% | 91.03% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.36% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 80.88% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 80.12% | 91.49% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.00% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Leptospermum scoparium |
PubChem | 163191026 |
LOTUS | LTS0075293 |
wikiData | Q105154989 |