3,6-Dimethyl-9-propan-2-ylspiro[4.5]dec-3-en-10-ol
| Internal ID | 20aec412-6302-467f-90d7-92ea6635f1d4 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Menthane monoterpenoids |
| IUPAC Name | 3,6-dimethyl-9-propan-2-ylspiro[4.5]dec-3-en-10-ol |
| SMILES (Canonical) | CC1CCC(C(C12CCC(=C2)C)O)C(C)C |
| SMILES (Isomeric) | CC1CCC(C(C12CCC(=C2)C)O)C(C)C |
| InChI | InChI=1S/C15H26O/c1-10(2)13-6-5-12(4)15(14(13)16)8-7-11(3)9-15/h9-10,12-14,16H,5-8H2,1-4H3 |
| InChI Key | MYLXGCVCCZCOHU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.198365449 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 3.90 |
| 3,6-dimethyl-9-propan-2-ylspiro[4.5]dec-3-en-10-ol |
![2D Structure of 3,6-Dimethyl-9-propan-2-ylspiro[4.5]dec-3-en-10-ol](https://plantaedb.com/storage/docs/compounds/2023/11/36-dimethyl-9-propan-2-ylspiro45dec-3-en-10-ol.jpg "2D Structure of 3,6-Dimethyl-9-propan-2-ylspiro[4.5]dec-3-en-10-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.45% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.82% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.63% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.67% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.66% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.25% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.27% | 100.00% |
| CHEMBL4072 | P07858 | Cathepsin B | 85.19% | 93.67% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.17% | 95.89% |
| CHEMBL1871 | P10275 | Androgen Receptor | 81.89% | 96.43% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.25% | 86.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cryptomeria japonica |
| Juniperus oxycedrus |
| Pelargonium endlicherianum |
| PubChem | 14286039 |
| LOTUS | LTS0254894 |
| wikiData | Q104254134 |