3,6-dimethyl-1-(3-methylbut-1-enyl)-9H-carbazole
| Internal ID | 65a1c0ee-02c7-4229-8db5-67eafdc8ee82 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 3,6-dimethyl-1-(3-methylbut-1-enyl)-9H-carbazole |
| SMILES (Canonical) | CC1=CC2=C(C=C1)NC3=C(C=C(C=C23)C)C=CC(C)C |
| SMILES (Isomeric) | CC1=CC2=C(C=C1)NC3=C(C=C(C=C23)C)C=CC(C)C |
| InChI | InChI=1S/C19H21N/c1-12(2)5-7-15-9-14(4)11-17-16-10-13(3)6-8-18(16)20-19(15)17/h5-12,20H,1-4H3 |
| InChI Key | NKFUWPLVRXOQJH-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.167399674 g/mol |
| Topological Polar Surface Area (TPSA) | 15.80 Ų |
| XlogP | 5.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.22% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.32% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.89% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.93% | 95.56% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 90.99% | 97.23% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.49% | 85.14% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 90.26% | 85.30% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.89% | 93.99% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.97% | 94.75% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.27% | 96.00% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.63% | 91.71% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 85.49% | 94.80% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 84.87% | 91.49% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 84.71% | 95.56% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 84.13% | 98.59% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 83.74% | 93.31% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.62% | 96.09% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 83.08% | 93.18% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 82.97% | 83.10% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.74% | 89.62% |
| CHEMBL1829 | O15379 | Histone deacetylase 3 | 81.20% | 95.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.10% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.87% | 94.73% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.25% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Murraya koenigii |
| PubChem | 72751187 |
| LOTUS | LTS0031519 |
| wikiData | Q105180557 |