(E)-1-[2-hydroxy-4,6-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]phenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one
Internal ID | 157c3ea7-749d-4eeb-88b2-614a44cb5b76 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | (E)-1-[2-hydroxy-4,6-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]phenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
SMILES (Canonical) | C1=CC(=CC=C1C=CC(=O)C2=C(C=C(C=C2OC3C(C(C(C(O3)CO)O)O)O)OC4C(C(C(C(O4)CO)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1/C=C/C(=O)C2=C(C=C(C=C2O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)O |
InChI | InChI=1S/C27H32O15/c28-9-17-20(33)22(35)24(37)26(41-17)39-13-7-15(32)19(14(31)6-3-11-1-4-12(30)5-2-11)16(8-13)40-27-25(38)23(36)21(34)18(10-29)42-27/h1-8,17-18,20-30,32-38H,9-10H2/b6-3+/t17-,18-,20-,21-,22+,23+,24-,25-,26-,27-/m1/s1 |
InChI Key | QTLVRDBUJNNTDS-BUIGSLFCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H32O15 |
Molecular Weight | 596.50 g/mol |
Exact Mass | 596.17412031 g/mol |
Topological Polar Surface Area (TPSA) | 256.00 Ų |
XlogP | -0.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.99% | 91.11% |
CHEMBL3194 | P02766 | Transthyretin | 95.98% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.80% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.39% | 89.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.89% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.47% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.34% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.03% | 97.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.63% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.42% | 95.56% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.36% | 91.71% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 86.35% | 89.67% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.05% | 90.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.51% | 95.89% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.67% | 95.50% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.35% | 89.62% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.23% | 86.92% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.05% | 85.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.02% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Asarum canadense |
Helichrysum arenarium |
PubChem | 14854161 |
LOTUS | LTS0207365 |
wikiData | Q105227796 |