4-[[(3R,4aS,6aS,7R,10aR,10bS)-3-ethenyl-3,4a,7,10a-tetramethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-7-yl]methoxy]-4-oxobutanoic acid
| Internal ID | 7a7eadb6-46b0-48a9-b6b4-cde4e5fa220a |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | 4-[[(3R,4aS,6aS,7R,10aR,10bS)-3-ethenyl-3,4a,7,10a-tetramethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-7-yl]methoxy]-4-oxobutanoic acid |
| SMILES (Canonical) | CC1(CCCC2(C1CCC3(C2CCC(O3)(C)C=C)C)C)COC(=O)CCC(=O)O |
| SMILES (Isomeric) | C[C@]1(CCC[C@@]2([C@@H]1CC[C@]3([C@H]2CC[C@](O3)(C)C=C)C)C)COC(=O)CCC(=O)O |
| InChI | InChI=1S/C24H38O5/c1-6-22(3)14-10-18-23(4)13-7-12-21(2,16-28-20(27)9-8-19(25)26)17(23)11-15-24(18,5)29-22/h6,17-18H,1,7-16H2,2-5H3,(H,25,26)/t17-,18+,21+,22+,23-,24+/m1/s1 |
| InChI Key | PKNLEHJRRPUQDE-BDADTYDISA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.27192431 g/mol |
| Topological Polar Surface Area (TPSA) | 72.80 Ų |
| XlogP | 4.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.08% | 90.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.93% | 96.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 93.37% | 91.19% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.84% | 91.11% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 91.49% | 96.38% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 91.11% | 83.82% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.11% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.54% | 97.09% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.51% | 95.50% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.93% | 86.33% |
| CHEMBL5028 | O14672 | ADAM10 | 85.03% | 97.50% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.60% | 92.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.49% | 95.89% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.38% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.31% | 99.17% |
| CHEMBL233 | P35372 | Mu opioid receptor | 82.30% | 97.93% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.79% | 94.00% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 80.71% | 98.10% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.55% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Leiocarpa semicalva |
| PubChem | 163091359 |
| LOTUS | LTS0075754 |
| wikiData | Q105210514 |