(2S)-4-[(2R)-2-hydroxy-7-[(2R,5R)-5-[(1R,2R,4S,5R)-1,2,4,5-tetrahydroxynonadecyl]oxolan-2-yl]heptyl]-2-methyl-2H-furan-5-one
Internal ID | c503eaa3-2fac-49f5-84a8-db2dc178edc8 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols > Annonaceous acetogenins |
IUPAC Name | (2S)-4-[(2R)-2-hydroxy-7-[(2R,5R)-5-[(1R,2R,4S,5R)-1,2,4,5-tetrahydroxynonadecyl]oxolan-2-yl]heptyl]-2-methyl-2H-furan-5-one |
SMILES (Canonical) | CCCCCCCCCCCCCCC(C(CC(C(C1CCC(O1)CCCCCC(CC2=CC(OC2=O)C)O)O)O)O)O |
SMILES (Isomeric) | CCCCCCCCCCCCCC[C@H]([C@H](C[C@H]([C@H]([C@H]1CC[C@H](O1)CCCCC[C@H](CC2=C[C@@H](OC2=O)C)O)O)O)O)O |
InChI | InChI=1S/C35H64O8/c1-3-4-5-6-7-8-9-10-11-12-13-17-20-30(37)31(38)25-32(39)34(40)33-22-21-29(43-33)19-16-14-15-18-28(36)24-27-23-26(2)42-35(27)41/h23,26,28-34,36-40H,3-22,24-25H2,1-2H3/t26-,28+,29+,30+,31-,32+,33+,34+/m0/s1 |
InChI Key | DZDIYBYUWLLBAD-SIQKIFQBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H64O8 |
Molecular Weight | 612.90 g/mol |
Exact Mass | 612.46011900 g/mol |
Topological Polar Surface Area (TPSA) | 137.00 Ų |
XlogP | 7.80 |
There are no found synonyms. |
![2D Structure of (2S)-4-[(2R)-2-hydroxy-7-[(2R,5R)-5-[(1R,2R,4S,5R)-1,2,4,5-tetrahydroxynonadecyl]oxolan-2-yl]heptyl]-2-methyl-2H-furan-5-one 2D Structure of (2S)-4-[(2R)-2-hydroxy-7-[(2R,5R)-5-[(1R,2R,4S,5R)-1,2,4,5-tetrahydroxynonadecyl]oxolan-2-yl]heptyl]-2-methyl-2H-furan-5-one](https://plantaedb.com/storage/docs/compounds/2023/11/35ac96c0-8771-11ee-8dad-896c41df3862.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.62% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.86% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.71% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.55% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.16% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.66% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.54% | 94.73% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.10% | 93.56% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 88.88% | 97.79% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 88.69% | 89.63% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 88.51% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.32% | 95.56% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 86.40% | 97.29% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 86.01% | 92.08% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.29% | 96.47% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.08% | 100.00% |
CHEMBL299 | P17252 | Protein kinase C alpha | 84.15% | 98.03% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.51% | 86.33% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 83.48% | 92.88% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.62% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.35% | 99.23% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.73% | 92.86% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.42% | 93.18% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.57% | 90.24% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 80.38% | 98.33% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.27% | 97.14% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 80.25% | 91.81% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Annona muricata |
PubChem | 154497041 |
LOTUS | LTS0220272 |
wikiData | Q104991749 |