[4-[[8-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-yl)-5-acetyloxy-2-hydroxy-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methoxy]-4-oxobutan-2-yl] 3-acetyloxybutanoate
Internal ID | 64686a6a-0646-426e-8346-eca871b5b3e3 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tetracarboxylic acids and derivatives |
IUPAC Name | [4-[[8-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-yl)-5-acetyloxy-2-hydroxy-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methoxy]-4-oxobutan-2-yl] 3-acetyloxybutanoate |
SMILES (Canonical) | CC1CC(C2(C(C1(C)C3CC4CCOC4O3)CC(CC25CO5)O)COC(=O)CC(C)OC(=O)CC(C)OC(=O)C)OC(=O)C |
SMILES (Isomeric) | CC1CC(C2(C(C1(C)C3CC4CCOC4O3)CC(CC25CO5)O)COC(=O)CC(C)OC(=O)CC(C)OC(=O)C)OC(=O)C |
InChI | InChI=1S/C32H48O12/c1-17-9-26(43-21(5)34)32(16-39-27(36)10-19(3)42-28(37)11-18(2)41-20(4)33)24(13-23(35)14-31(32)15-40-31)30(17,6)25-12-22-7-8-38-29(22)44-25/h17-19,22-26,29,35H,7-16H2,1-6H3 |
InChI Key | LVCRNDTYLGTGKQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H48O12 |
Molecular Weight | 624.70 g/mol |
Exact Mass | 624.31457696 g/mol |
Topological Polar Surface Area (TPSA) | 156.00 Ų |
XlogP | 2.40 |
There are no found synonyms. |
![2D Structure of [4-[[8-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-yl)-5-acetyloxy-2-hydroxy-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methoxy]-4-oxobutan-2-yl] 3-acetyloxybutanoate 2D Structure of [4-[[8-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-yl)-5-acetyloxy-2-hydroxy-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methoxy]-4-oxobutan-2-yl] 3-acetyloxybutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/35a7e420-85f5-11ee-b89e-dbd5b65264af.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.91% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.92% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.97% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.77% | 97.25% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 93.51% | 97.21% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 93.25% | 96.95% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 92.91% | 89.05% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.48% | 82.69% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.42% | 91.11% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.32% | 91.19% |
CHEMBL2581 | P07339 | Cathepsin D | 89.90% | 98.95% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 88.45% | 97.28% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 87.02% | 97.79% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.96% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.84% | 86.33% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.61% | 95.93% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 85.19% | 95.69% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 84.41% | 95.71% |
CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 84.29% | 97.56% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.06% | 91.07% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.68% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.47% | 97.14% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.91% | 98.75% |
CHEMBL299 | P17252 | Protein kinase C alpha | 82.85% | 98.03% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 82.81% | 95.71% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.67% | 96.77% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.61% | 96.47% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.38% | 100.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.19% | 90.17% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.50% | 95.89% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.36% | 94.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.90% | 85.14% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.19% | 92.50% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.12% | 89.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Scutellaria pontica |
PubChem | 85237241 |
LOTUS | LTS0082881 |
wikiData | Q105157778 |