12b-[5-(4,5-Dihydroxy-6-methyloxan-2-yl)oxy-6-methyloxan-2-yl]oxy-3,4a,8-trihydroxy-3-methyl-2,4-dihydrobenzo[a]anthracene-1,7,12-trione
| Internal ID | 6a4da1c4-2538-48a4-9426-8db21166b3a2 |
| Taxonomy | Benzenoids > Anthracenes > Anthraquinones > Anthraquinone glycosides |
| IUPAC Name | 12b-[5-(4,5-dihydroxy-6-methyloxan-2-yl)oxy-6-methyloxan-2-yl]oxy-3,4a,8-trihydroxy-3-methyl-2,4-dihydrobenzo[a]anthracene-1,7,12-trione |
| SMILES (Canonical) | CC1C(CCC(O1)OC23C(=O)CC(CC2(C=CC4=C3C(=O)C5=C(C4=O)C(=CC=C5)O)O)(C)O)OC6CC(C(C(O6)C)O)O |
| SMILES (Isomeric) | CC1C(CCC(O1)OC23C(=O)CC(CC2(C=CC4=C3C(=O)C5=C(C4=O)C(=CC=C5)O)O)(C)O)OC6CC(C(C(O6)C)O)O |
| InChI | InChI=1S/C31H36O12/c1-14-20(42-23-11-19(33)26(35)15(2)41-23)7-8-22(40-14)43-31-21(34)12-29(3,38)13-30(31,39)10-9-17-25(31)28(37)16-5-4-6-18(32)24(16)27(17)36/h4-6,9-10,14-15,19-20,22-23,26,32-33,35,38-39H,7-8,11-13H2,1-3H3 |
| InChI Key | UKEUSFCSLQPUQI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C31H36O12 |
| Molecular Weight | 600.60 g/mol |
| Exact Mass | 600.22067658 g/mol |
| Topological Polar Surface Area (TPSA) | 189.00 Ų |
| XlogP | 0.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.73% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.55% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.09% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 96.54% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.22% | 95.56% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 94.83% | 95.93% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.83% | 89.00% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 94.47% | 96.77% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 93.53% | 96.38% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.32% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.82% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.30% | 96.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.24% | 94.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.88% | 94.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.30% | 95.89% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 87.94% | 97.79% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.78% | 86.33% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 87.59% | 97.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.79% | 85.14% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 86.76% | 96.67% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.97% | 96.21% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.24% | 97.14% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.95% | 92.94% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.51% | 99.15% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.15% | 96.95% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.54% | 91.19% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 80.38% | 96.00% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 80.31% | 83.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162943374 |
| LOTUS | LTS0090752 |
| wikiData | Q104198302 |