2-(4-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one
Internal ID | 2cfd7166-d65c-407f-9da9-af587545e6c7 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 2-(4-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC4=C(C=C3)C(=O)C=C(O4)C5=CC=C(C=C5)OC)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC4=C(C=C3)C(=O)C=C(O4)C5=CC=C(C=C5)OC)O)O)O)O)O)O |
InChI | InChI=1S/C28H32O13/c1-12-21(30)23(32)25(34)27(38-12)37-11-20-22(31)24(33)26(35)28(41-20)39-15-7-8-16-17(29)10-18(40-19(16)9-15)13-3-5-14(36-2)6-4-13/h3-10,12,20-28,30-35H,11H2,1-2H3/t12-,20+,21-,22+,23+,24-,25+,26+,27-,28+/m0/s1 |
InChI Key | VDRRDZMMTOMOMR-WBFJRLOVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H32O13 |
Molecular Weight | 576.50 g/mol |
Exact Mass | 576.18429107 g/mol |
Topological Polar Surface Area (TPSA) | 194.00 Ų |
XlogP | -0.70 |
There are no found synonyms. |
![2D Structure of 2-(4-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one 2D Structure of 2-(4-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/35682620-85d4-11ee-b544-25d0c39d84bd.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.37% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.94% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.50% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.49% | 85.14% |
CHEMBL1907 | P15144 | Aminopeptidase N | 94.83% | 93.31% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.64% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.50% | 86.33% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 91.75% | 97.36% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 91.42% | 83.57% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 90.87% | 81.11% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.58% | 86.92% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.30% | 95.56% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 89.43% | 87.67% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 88.94% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.24% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.18% | 97.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.66% | 94.73% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.42% | 99.15% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.15% | 95.89% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.02% | 95.89% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.71% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.62% | 99.17% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.43% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Scoparia dulcis |
PubChem | 163027392 |
LOTUS | LTS0179689 |
wikiData | Q105284340 |