[(3R,5R,6R)-2,5-dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxybenzoyl)oxyoxan-4-yl] 3,4,5-trihydroxy-2-[(7,13,14-trihydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-6-yl)oxy]benzoate
Internal ID | 9956a7d6-7d48-482f-bc71-ff38221cda04 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(3R,5R,6R)-2,5-dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxybenzoyl)oxyoxan-4-yl] 3,4,5-trihydroxy-2-[(7,13,14-trihydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-6-yl)oxy]benzoate |
SMILES (Canonical) | C1=C(C=C(C(=C1O)O)O)C(=O)OC2C(C(C(OC2O)CO)O)OC(=O)C3=CC(=C(C(=C3OC4=C(C5=C6C(=C4)C(=O)OC7=C6C(=CC(=C7O)O)C(=O)O5)O)O)O)O |
SMILES (Isomeric) | C1=C(C=C(C(=C1O)O)O)C(=O)O[C@@H]2C([C@@H]([C@H](OC2O)CO)O)OC(=O)C3=CC(=C(C(=C3OC4=C(C5=C6C(=C4)C(=O)OC7=C6C(=CC(=C7O)O)C(=O)O5)O)O)O)O |
InChI | InChI=1S/C34H24O22/c35-6-16-23(44)28(29(34(50)52-16)56-30(46)7-1-11(36)19(40)12(37)2-7)55-33(49)10-4-13(38)20(41)24(45)25(10)51-15-5-9-18-17-8(31(47)54-27(18)22(15)43)3-14(39)21(42)26(17)53-32(9)48/h1-5,16,23,28-29,34-45,50H,6H2/t16-,23-,28?,29-,34?/m1/s1 |
InChI Key | QLDUHPWCLDKEEA-HJIAJRGXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C34H24O22 |
Molecular Weight | 784.50 g/mol |
Exact Mass | 784.07592239 g/mol |
Topological Polar Surface Area (TPSA) | 366.00 Ų |
XlogP | 0.80 |
There are no found synonyms. |
![2D Structure of [(3R,5R,6R)-2,5-dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxybenzoyl)oxyoxan-4-yl] 3,4,5-trihydroxy-2-[(7,13,14-trihydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-6-yl)oxy]benzoate 2D Structure of [(3R,5R,6R)-2,5-dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxybenzoyl)oxyoxan-4-yl] 3,4,5-trihydroxy-2-[(7,13,14-trihydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-6-yl)oxy]benzoate](https://plantaedb.com/storage/docs/compounds/2023/11/35539250-85b2-11ee-8076-4f0ec806d179.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.72% | 91.11% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 97.35% | 89.34% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.17% | 94.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.09% | 91.49% |
CHEMBL3194 | P02766 | Transthyretin | 94.13% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.74% | 89.00% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 92.20% | 94.42% |
CHEMBL2581 | P07339 | Cathepsin D | 90.37% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.22% | 99.17% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 90.14% | 96.21% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 89.83% | 83.57% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 89.25% | 83.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.15% | 95.56% |
CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 83.22% | 95.71% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 83.08% | 96.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.94% | 86.92% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 81.98% | 95.17% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.74% | 92.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.63% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.38% | 99.23% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.25% | 95.83% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.44% | 99.15% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.17% | 95.89% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.02% | 95.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Epilobium hirsutum |
PubChem | 163033013 |
LOTUS | LTS0075127 |
wikiData | Q105223506 |