3-[4-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxyphenyl]-5-hydroxy-7-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one
Internal ID | b87d62bc-d091-4f7b-ac17-86938d5615c2 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavonoid O-glycosides |
IUPAC Name | 3-[4-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxyphenyl]-5-hydroxy-7-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC=C(C3=O)C4=CC=C(C=C4)OC5C(C(C(C(O5)CO)O)O)OC6C(C(C(C(O6)CO)O)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)OC2=CC(=C3C(=C2)OC=C(C3=O)C4=CC=C(C=C4)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O[C@H]6[C@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)O)O)O)O |
InChI | InChI=1S/C33H40O19/c1-11-21(37)25(41)28(44)31(47-11)49-14-6-16(36)20-17(7-14)46-10-15(22(20)38)12-2-4-13(5-3-12)48-33-30(27(43)24(40)19(9-35)51-33)52-32-29(45)26(42)23(39)18(8-34)50-32/h2-7,10-11,18-19,21,23-37,39-45H,8-9H2,1H3/t11-,18-,19-,21+,23-,24-,25-,26+,27+,28+,29+,30-,31+,32+,33-/m1/s1 |
InChI Key | GBAQGJJKVNSNNJ-PDUYSMBWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H40O19 |
Molecular Weight | 740.70 g/mol |
Exact Mass | 740.21637904 g/mol |
Topological Polar Surface Area (TPSA) | 304.00 Ų |
XlogP | -2.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.27% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.29% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.61% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.93% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.99% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.98% | 91.49% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.32% | 86.92% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.93% | 99.15% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 90.16% | 97.36% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 90.06% | 96.21% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.14% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.04% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.11% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.78% | 96.09% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.94% | 95.78% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.71% | 95.93% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.65% | 90.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.39% | 94.73% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.47% | 90.71% |
CHEMBL1907 | P15144 | Aminopeptidase N | 82.11% | 93.31% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.83% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Styphnolobium japonicum |
PubChem | 162866673 |
LOTUS | LTS0140171 |
wikiData | Q105005734 |