N-[(2S,3S,5R,6E,9E)-3,5-dihydroxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptacosa-6,9-dien-2-yl]pentadecanamide
Internal ID | 8d44eaf4-6713-4905-bb69-5e21a085ed49 |
Taxonomy | Lipids and lipid-like molecules > Sphingolipids > Glycosphingolipids |
IUPAC Name | N-[(2S,3S,5R,6E,9E)-3,5-dihydroxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptacosa-6,9-dien-2-yl]pentadecanamide |
SMILES (Canonical) | CCCCCCCCCCCCCCCCCC=CCC=CC(CC(C(COC1C(C(C(C(O1)CO)O)O)O)NC(=O)CCCCCCCCCCCCCC)O)O |
SMILES (Isomeric) | CCCCCCCCCCCCCCCCC/C=C/C/C=C/[C@@H](C[C@@H]([C@H](CO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)NC(=O)CCCCCCCCCCCCCC)O)O |
InChI | InChI=1S/C48H91NO9/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-23-24-25-27-29-31-33-35-40(51)37-42(52)41(39-57-48-47(56)46(55)45(54)43(38-50)58-48)49-44(53)36-34-32-30-28-26-16-14-12-10-8-6-4-2/h27,29,33,35,40-43,45-48,50-52,54-56H,3-26,28,30-32,34,36-39H2,1-2H3,(H,49,53)/b29-27+,35-33+/t40-,41-,42-,43+,45+,46-,47+,48+/m0/s1 |
InChI Key | HZVBMWDBPDFSPH-XWANGMJUSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H91NO9 |
Molecular Weight | 826.20 g/mol |
Exact Mass | 825.66938348 g/mol |
Topological Polar Surface Area (TPSA) | 169.00 Ų |
XlogP | 13.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 99.48% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 99.33% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.81% | 91.11% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 96.38% | 89.63% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 95.14% | 97.29% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.76% | 96.09% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 94.72% | 92.86% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 94.11% | 92.50% |
CHEMBL220 | P22303 | Acetylcholinesterase | 93.94% | 94.45% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 93.05% | 83.82% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.01% | 93.56% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 92.28% | 85.94% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.43% | 90.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.23% | 96.00% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 90.68% | 92.08% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.04% | 94.73% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.92% | 96.47% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.83% | 100.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.73% | 96.95% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.29% | 100.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.14% | 94.33% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 85.95% | 92.32% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 85.74% | 91.24% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.06% | 89.00% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 81.90% | 92.88% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 81.54% | 91.81% |
CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 81.06% | 95.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Erigeron canadensis |
PubChem | 162901208 |
LOTUS | LTS0192875 |
wikiData | Q105035903 |