[(1S,2S,3S,4R,5R,6R,7S,9R,12R)-4,12-diacetyloxy-2,3-dihydroxy-2,6,10,10-tetramethyl-7-[(E)-3-phenylprop-2-enoyl]oxy-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] benzoate
| Internal ID | d203f5e0-89a0-4dc1-acbf-a86a5d3ea3f6 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Agarofurans |
| IUPAC Name | [(1S,2S,3S,4R,5R,6R,7S,9R,12R)-4,12-diacetyloxy-2,3-dihydroxy-2,6,10,10-tetramethyl-7-[(E)-3-phenylprop-2-enoyl]oxy-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] benzoate |
| SMILES (Canonical) | CC(=O)OC1C(C(C23C(C(CC(C2(C1OC(=O)C4=CC=CC=C4)C)OC(=O)C=CC5=CC=CC=C5)C(O3)(C)C)OC(=O)C)(C)O)O |
| SMILES (Isomeric) | CC(=O)O[C@@H]1[C@@H]([C@]([C@@]23[C@@H]([C@@H](C[C@@H]([C@@]2([C@H]1OC(=O)C4=CC=CC=C4)C)OC(=O)/C=C/C5=CC=CC=C5)C(O3)(C)C)OC(=O)C)(C)O)O |
| InChI | InChI=1S/C35H40O11/c1-20(36)42-27-28(39)34(6,41)35-29(43-21(2)37)24(32(3,4)46-35)19-25(44-26(38)18-17-22-13-9-7-10-14-22)33(35,5)30(27)45-31(40)23-15-11-8-12-16-23/h7-18,24-25,27-30,39,41H,19H2,1-6H3/b18-17+/t24-,25+,27-,28+,29-,30+,33-,34+,35-/m1/s1 |
| InChI Key | TXFGQQCHKBHRQF-UJWWHINYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C35H40O11 |
| Molecular Weight | 636.70 g/mol |
| Exact Mass | 636.25706209 g/mol |
| Topological Polar Surface Area (TPSA) | 155.00 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.54% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.29% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.18% | 90.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.08% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.42% | 96.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.08% | 93.99% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 90.61% | 95.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.91% | 96.00% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 89.60% | 81.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.88% | 85.14% |
| CHEMBL5028 | O14672 | ADAM10 | 87.52% | 97.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.84% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.70% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.30% | 99.23% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 85.97% | 89.44% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.85% | 91.19% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 83.84% | 97.79% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.60% | 94.62% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.34% | 97.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.31% | 97.09% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 83.20% | 94.08% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.12% | 90.00% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 80.74% | 83.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.50% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10461752 |
| LOTUS | LTS0121156 |
| wikiData | Q105266707 |