3,5-Dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14,16,18-hexaen-13-one
Internal ID | 51046e13-ebe5-4452-ae8d-7894416ea603 |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | 3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14,16,18-hexaen-13-one |
SMILES (Canonical) | C1CNC2C3=C(C4=CC=CC=C4C2=O)C5=C(C=C31)OCO5 |
SMILES (Isomeric) | C1CNC2C3=C(C4=CC=CC=C4C2=O)C5=C(C=C31)OCO5 |
InChI | InChI=1S/C17H13NO3/c19-16-11-4-2-1-3-10(11)14-13-9(5-6-18-15(13)16)7-12-17(14)21-8-20-12/h1-4,7,15,18H,5-6,8H2 |
InChI Key | PGYODQHPEOMMMH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H13NO3 |
Molecular Weight | 279.29 g/mol |
Exact Mass | 279.08954328 g/mol |
Topological Polar Surface Area (TPSA) | 47.60 Ų |
XlogP | 2.50 |
There are no found synonyms. |
![2D Structure of 3,5-Dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14,16,18-hexaen-13-one 2D Structure of 3,5-Dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14,16,18-hexaen-13-one](https://plantaedb.com/storage/docs/compounds/2023/11/35-dioxa-11-azapentacyclo1071026082001419icosa-120267141618-hexaen-13-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.03% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.39% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.14% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.75% | 95.56% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.48% | 96.77% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.57% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.29% | 86.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.11% | 92.62% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.01% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.16% | 99.23% |
CHEMBL2535 | P11166 | Glucose transporter | 83.70% | 98.75% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 81.64% | 82.67% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.78% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cananga odorata |
PubChem | 15524047 |
LOTUS | LTS0182994 |
wikiData | Q105208790 |