3,5-Dihydroxy-3',4'-dimethoxy-6,7-methylenedioxyflavone 3-glucuronide
Internal ID | 84e8132b-94bf-4851-b690-572f98cb7637 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glucuronides > Flavonoid-3-O-glucuronides |
IUPAC Name | 6-[[6-(3,4-dimethoxyphenyl)-9-hydroxy-8-oxo-[1,3]dioxolo[4,5-g]chromen-7-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
SMILES (Canonical) | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C4=C(C=C3O2)OCO4)O)OC5C(C(C(C(O5)C(=O)O)O)O)O)OC |
SMILES (Isomeric) | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C4=C(C=C3O2)OCO4)O)OC5C(C(C(C(O5)C(=O)O)O)O)O)OC |
InChI | InChI=1S/C24H22O14/c1-32-9-4-3-8(5-10(9)33-2)19-21(37-24-18(29)16(27)17(28)22(38-24)23(30)31)15(26)13-11(36-19)6-12-20(14(13)25)35-7-34-12/h3-6,16-18,22,24-25,27-29H,7H2,1-2H3,(H,30,31) |
InChI Key | MRRDNEKQNDQHAF-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H22O14 |
Molecular Weight | 534.40 g/mol |
Exact Mass | 534.10095537 g/mol |
Topological Polar Surface Area (TPSA) | 200.00 Ų |
XlogP | 1.40 |
CHEBI:175966 |
6-[[6-(3,4-dimethoxyphenyl)-9-hydroxy-8-oxo-[1,3]dioxolo[4,5-g]chromen-7-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.56% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.49% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.76% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 96.05% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.11% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.01% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.82% | 94.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.40% | 96.77% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.26% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.82% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.52% | 99.17% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.29% | 92.62% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.11% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.31% | 95.89% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.10% | 96.00% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.92% | 95.78% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.71% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.44% | 99.23% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.17% | 97.36% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.00% | 95.50% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 80.42% | 95.64% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 80.20% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Spinacia oleracea |
PubChem | 73119625 |
LOTUS | LTS0163131 |
wikiData | Q105170855 |