3,5-Dihydroxy-2-(4-hydroxyphenyl)-7-(3-methylbut-2-enoxy)-2,3-dihydrochromen-4-one
Internal ID | 4a4c7b58-9a6a-42a7-ba62-a1253a6babaf |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > Flavanones > Flavanonols |
IUPAC Name | 3,5-dihydroxy-2-(4-hydroxyphenyl)-7-(3-methylbut-2-enoxy)-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC(=CCOC1=CC(=C2C(=C1)OC(C(C2=O)O)C3=CC=C(C=C3)O)O)C |
SMILES (Isomeric) | CC(=CCOC1=CC(=C2C(=C1)OC(C(C2=O)O)C3=CC=C(C=C3)O)O)C |
InChI | InChI=1S/C20H20O6/c1-11(2)7-8-25-14-9-15(22)17-16(10-14)26-20(19(24)18(17)23)12-3-5-13(21)6-4-12/h3-7,9-10,19-22,24H,8H2,1-2H3 |
InChI Key | CITFYDYEWQIEPX-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H20O6 |
Molecular Weight | 356.40 g/mol |
Exact Mass | 356.12598835 g/mol |
Topological Polar Surface Area (TPSA) | 96.20 Ų |
XlogP | 3.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.04% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 95.37% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 92.84% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.60% | 91.49% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.00% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.89% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.74% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.42% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.26% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.02% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.81% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.74% | 97.09% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 84.71% | 93.10% |
CHEMBL240 | Q12809 | HERG | 84.69% | 89.76% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.18% | 99.23% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.76% | 94.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.02% | 90.00% |
CHEMBL2535 | P11166 | Glucose transporter | 80.25% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Moquiniastrum paniculatum |
Pterocaulon virgatum |
PubChem | 74193158 |
LOTUS | LTS0251588 |
wikiData | Q104960246 |