3,5-Decanediol, 1-(4-hydroxy-3-methoxyphenyl)-, 5-acetate, (3R,5S)-
| Internal ID | f8e966e7-36bd-4d30-8367-3f9ba82939f8 |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | [(3R,5S)-3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)decan-5-yl] acetate |
| SMILES (Canonical) | CCCCCC(CC(CCC1=CC(=C(C=C1)O)OC)O)OC(=O)C |
| SMILES (Isomeric) | CCCCC[C@@H](C[C@@H](CCC1=CC(=C(C=C1)O)OC)O)OC(=O)C |
| InChI | InChI=1S/C19H30O5/c1-4-5-6-7-17(24-14(2)20)13-16(21)10-8-15-9-11-18(22)19(12-15)23-3/h9,11-12,16-17,21-22H,4-8,10,13H2,1-3H3/t16-,17+/m1/s1 |
| InChI Key | SLEAGHNVFZTGGH-SJORKVTESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.20932405 g/mol |
| Topological Polar Surface Area (TPSA) | 76.00 Ų |
| XlogP | 4.20 |
| 3,5-Decanediol, 1-(4-hydroxy-3-methoxyphenyl)-, 5-acetate, (3R,5S)- |
| 143519-16-8 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.06% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.23% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.91% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.73% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.09% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.58% | 86.33% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.76% | 97.25% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.16% | 96.95% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.39% | 100.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 89.27% | 90.20% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 87.74% | 93.31% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 85.55% | 95.17% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.28% | 90.71% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 85.08% | 92.08% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.38% | 95.50% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.34% | 97.21% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.93% | 98.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.13% | 95.56% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 82.29% | 100.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.18% | 95.89% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.13% | 94.73% |
| CHEMBL240 | Q12809 | HERG | 81.58% | 89.76% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.51% | 93.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.43% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zingiber officinale |
| PubChem | 129864179 |
| LOTUS | LTS0140718 |
| wikiData | Q105255229 |