3,5-Bis(4-hydroxyphenyl)pent-4-ene-1,2-diol
| Internal ID | ea908fd0-c8e5-4fe6-bc7a-6ec6ca14f38f |
| Taxonomy | Lignans, neolignans and related compounds |
| IUPAC Name | 3,5-bis(4-hydroxyphenyl)pent-4-ene-1,2-diol |
| SMILES (Canonical) | C1=CC(=CC=C1C=CC(C2=CC=C(C=C2)O)C(CO)O)O |
| SMILES (Isomeric) | C1=CC(=CC=C1C=CC(C2=CC=C(C=C2)O)C(CO)O)O |
| InChI | InChI=1S/C17H18O4/c18-11-17(21)16(13-4-8-15(20)9-5-13)10-3-12-1-6-14(19)7-2-12/h1-10,16-21H,11H2 |
| InChI Key | DVUXXXYVVWRAIA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.12050905 g/mol |
| Topological Polar Surface Area (TPSA) | 80.90 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL242 | Q92731 | Estrogen receptor beta | 98.53% | 98.35% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.45% | 91.11% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 90.91% | 89.67% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 90.60% | 93.10% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.08% | 96.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.23% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.35% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.51% | 95.56% |
| CHEMBL3194 | P02766 | Transthyretin | 85.38% | 90.71% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.35% | 96.09% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.21% | 89.62% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.01% | 90.00% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 81.79% | 83.10% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.67% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cryptomeria japonica |
| Metasequoia glyptostroboides |
| PubChem | 614400 |
| LOTUS | LTS0160294 |
| wikiData | Q104990369 |