3,5-bis[(2S)-1-methylpyrrolidin-2-yl]pyridine
Internal ID | cc0185dc-0e83-4a20-a589-b4534252b386 |
Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Pyrrolidinylpyridines |
IUPAC Name | 3,5-bis[(2S)-1-methylpyrrolidin-2-yl]pyridine |
SMILES (Canonical) | CN1CCCC1C2=CC(=CN=C2)C3CCCN3C |
SMILES (Isomeric) | CN1CCC[C@H]1C2=CC(=CN=C2)[C@@H]3CCCN3C |
InChI | InChI=1S/C15H23N3/c1-17-7-3-5-14(17)12-9-13(11-16-10-12)15-6-4-8-18(15)2/h9-11,14-15H,3-8H2,1-2H3/t14-,15-/m0/s1 |
InChI Key | CFMWWRWPGBAHFT-GJZGRUSLSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C15H23N3 |
Molecular Weight | 245.36 g/mol |
Exact Mass | 245.189197746 g/mol |
Topological Polar Surface Area (TPSA) | 19.40 Ų |
XlogP | 1.60 |
BDBM50548709 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.63% | 96.09% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 95.29% | 99.18% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 94.21% | 93.40% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.29% | 95.89% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 85.70% | 97.53% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 85.41% | 98.46% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 85.27% | 90.71% |
CHEMBL2581 | P07339 | Cathepsin D | 85.13% | 98.95% |
CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 83.97% | 94.55% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 83.50% | 86.00% |
CHEMBL1938212 | Q9UPP1 | Histone lysine demethylase PHF8 | 82.07% | 98.33% |
CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 81.47% | 91.43% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.44% | 90.71% |
CHEMBL2094108 | P49354 | Protein farnesyltransferase | 81.43% | 97.92% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.05% | 85.14% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.71% | 93.65% |
CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 80.60% | 92.86% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.26% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Nicotiana tabacum |
PubChem | 162658627 |
LOTUS | LTS0194013 |
wikiData | Q104956751 |