2-amino-4-[[1-[[6-(2-amino-2-oxoethyl)-3-[[4-hydroxy-2-methyl-6-oxo-6-[(11,19,27,35-tetraamino-3-hydroxytetracontyl)amino]hexan-3-yl]carbamoyl]-2-methyl-5,8,11-trioxo-1,4,7-triazacycloundec-9-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-4-oxobutanoic acid
| Internal ID | 0e43de04-e3e9-4db2-a0e1-0c0b8c12f118 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | 2-amino-4-[[1-[[6-(2-amino-2-oxoethyl)-3-[[4-hydroxy-2-methyl-6-oxo-6-[(11,19,27,35-tetraamino-3-hydroxytetracontyl)amino]hexan-3-yl]carbamoyl]-2-methyl-5,8,11-trioxo-1,4,7-triazacycloundec-9-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES (Canonical) | CCCCCC(CCCCCCCC(CCCCCCCC(CCCCCCCC(CCCCCCCC(CCNC(=O)CC(C(C(C)C)NC(=O)C1C(NC(=O)CC(C(=O)NC(C(=O)N1)CC(=O)N)NC(=O)C(CC2=CN=CN2)NC(=O)CC(C(=O)O)N)C)O)O)N)N)N)N |
| SMILES (Isomeric) | CCCCCC(CCCCCCCC(CCCCCCCC(CCCCCCCC(CCCCCCCC(CCNC(=O)CC(C(C(C)C)NC(=O)C1C(NC(=O)CC(C(=O)NC(C(=O)N1)CC(=O)N)NC(=O)C(CC2=CN=CN2)NC(=O)CC(C(=O)O)N)C)O)O)N)N)N)N |
| InChI | InChI=1S/C69H129N15O12/c1-5-6-19-28-48(70)29-20-11-7-12-21-30-49(71)31-22-13-8-14-23-32-50(72)33-24-15-9-16-25-34-51(73)35-26-17-10-18-27-36-53(85)37-38-77-60(88)43-58(86)63(46(2)3)83-68(94)64-47(4)79-62(90)42-57(66(92)81-56(41-59(75)87)67(93)84-64)82-65(91)55(39-52-44-76-45-78-52)80-61(89)40-54(74)69(95)96/h44-51,53-58,63-64,85-86H,5-43,70-74H2,1-4H3,(H2,75,87)(H,76,78)(H,77,88)(H,79,90)(H,80,89)(H,81,92)(H,82,91)(H,83,94)(H,84,93)(H,95,96) |
| InChI Key | DZSJXBQAXBOADW-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C69H129N15O12 |
| Molecular Weight | 1360.90 g/mol |
| Exact Mass | 1359.99451461 g/mol |
| Topological Polar Surface Area (TPSA) | 483.00 Ų |
| XlogP | 2.70 |
| Atomic LogP (AlogP) | 4.05 |
| H-Bond Acceptor | 17 |
| H-Bond Donor | 17 |
| Rotatable Bonds | 55 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8712 | 87.12% |
| Caco-2 | - | 0.8590 | 85.90% |
| Blood Brain Barrier | - | 0.9000 | 90.00% |
| Human oral bioavailability | - | 0.7714 | 77.14% |
| Subcellular localzation | Mitochondria | 0.4101 | 41.01% |
| OATP2B1 inhibitior | - | 0.8600 | 86.00% |
| OATP1B1 inhibitior | + | 0.8095 | 80.95% |
| OATP1B3 inhibitior | + | 0.9164 | 91.64% |
| MATE1 inhibitior | - | 0.8809 | 88.09% |
| OCT2 inhibitior | - | 0.9250 | 92.50% |
| BSEP inhibitior | + | 0.9489 | 94.89% |
| P-glycoprotein inhibitior | + | 0.7410 | 74.10% |
| P-glycoprotein substrate | + | 0.8757 | 87.57% |
| CYP3A4 substrate | + | 0.7252 | 72.52% |
| CYP2C9 substrate | - | 0.5983 | 59.83% |
| CYP2D6 substrate | - | 0.8325 | 83.25% |
| CYP3A4 inhibition | - | 0.7310 | 73.10% |
| CYP2C9 inhibition | - | 0.9121 | 91.21% |
| CYP2C19 inhibition | - | 0.9000 | 90.00% |
| CYP2D6 inhibition | - | 0.9231 | 92.31% |
| CYP1A2 inhibition | - | 0.9109 | 91.09% |
| CYP2C8 inhibition | + | 0.7702 | 77.02% |
| CYP inhibitory promiscuity | - | 0.9336 | 93.36% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.8700 | 87.00% |
| Carcinogenicity (trinary) | Non-required | 0.6264 | 62.64% |
| Eye corrosion | - | 0.9877 | 98.77% |
| Eye irritation | - | 0.8973 | 89.73% |
| Skin irritation | - | 0.7858 | 78.58% |
| Skin corrosion | - | 0.9291 | 92.91% |
| Ames mutagenesis | - | 0.5800 | 58.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6471 | 64.71% |
| Micronuclear | + | 0.7200 | 72.00% |
| Hepatotoxicity | - | 0.5125 | 51.25% |
| skin sensitisation | - | 0.8632 | 86.32% |
| Respiratory toxicity | + | 0.7889 | 78.89% |
| Reproductive toxicity | + | 0.9222 | 92.22% |
| Mitochondrial toxicity | + | 0.8000 | 80.00% |
| Nephrotoxicity | - | 0.7871 | 78.71% |
| Acute Oral Toxicity (c) | III | 0.6463 | 64.63% |
| Estrogen receptor binding | + | 0.7306 | 73.06% |
| Androgen receptor binding | + | 0.7078 | 70.78% |
| Thyroid receptor binding | + | 0.5835 | 58.35% |
| Glucocorticoid receptor binding | + | 0.5990 | 59.90% |
| Aromatase binding | + | 0.7041 | 70.41% |
| PPAR gamma | + | 0.7333 | 73.33% |
| Honey bee toxicity | - | 0.7231 | 72.31% |
| Biodegradation | - | 0.9000 | 90.00% |
| Crustacea aquatic toxicity | + | 0.5449 | 54.49% |
| Fish aquatic toxicity | + | 0.7125 | 71.25% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.90% | 98.95% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.67% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.15% | 96.09% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 99.12% | 97.23% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 98.01% | 94.55% |
| CHEMBL236 | P41143 | Delta opioid receptor | 97.47% | 99.35% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 96.85% | 88.42% |
| CHEMBL4801 | P29466 | Caspase-1 | 96.74% | 96.85% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 96.74% | 90.24% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 96.03% | 90.71% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 95.90% | 90.08% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.85% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.84% | 99.17% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 95.52% | 97.64% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 95.39% | 90.20% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.91% | 97.25% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.87% | 93.56% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 94.74% | 96.90% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 92.29% | 95.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 92.24% | 98.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.99% | 94.45% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 91.55% | 100.00% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 90.97% | 92.29% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 90.35% | 93.03% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.25% | 97.09% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.03% | 96.47% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.21% | 99.23% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 88.94% | 95.56% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 88.81% | 100.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 88.66% | 98.59% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 88.52% | 89.34% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 87.78% | 91.38% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 87.45% | 94.66% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 87.31% | 98.05% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 87.21% | 97.29% |
| CHEMBL5028 | O14672 | ADAM10 | 85.73% | 97.50% |
| CHEMBL233 | P35372 | Mu opioid receptor | 85.71% | 97.93% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.32% | 89.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.80% | 93.00% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 84.39% | 98.94% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.84% | 89.50% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.78% | 100.00% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 82.54% | 97.33% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 82.28% | 96.33% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 81.72% | 96.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.67% | 90.17% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 81.58% | 89.33% |
| CHEMBL2327 | P21452 | Neurokinin 2 receptor | 81.36% | 98.89% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 80.84% | 91.81% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.63% | 100.00% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 80.58% | 98.24% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.32% | 98.75% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 80.27% | 88.56% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 80.08% | 92.98% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146684682 |
| LOTUS | LTS0177477 |
| wikiData | Q104991979 |