methyl (1R,9R,16S,18R,21R)-15-hydroxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-18-carboxylate
Internal ID | dcbc5ef1-2086-458f-be18-315ade23c13a |
Taxonomy | Alkaloids and derivatives > Aspidofractine alkaloids |
IUPAC Name | methyl (1R,9R,16S,18R,21R)-15-hydroxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-18-carboxylate |
SMILES (Canonical) | COC(=O)C1CC23CCC14C5(C2N(CCC3O)CC5)C6=CC=CC=C6N4 |
SMILES (Isomeric) | COC(=O)[C@@H]1C[C@@]23CC[C@]14[C@@]5([C@H]2N(CCC3O)CC5)C6=CC=CC=C6N4 |
InChI | InChI=1S/C21H26N2O3/c1-26-17(25)14-12-19-7-8-21(14)20(13-4-2-3-5-15(13)22-21)9-11-23(18(19)20)10-6-16(19)24/h2-5,14,16,18,22,24H,6-12H2,1H3/t14-,16?,18-,19+,20+,21+/m0/s1 |
InChI Key | RZPUAAQUCIOUBB-DQOUOHSBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H26N2O3 |
Molecular Weight | 354.40 g/mol |
Exact Mass | 354.19434270 g/mol |
Topological Polar Surface Area (TPSA) | 61.80 Ų |
XlogP | 2.00 |
There are no found synonyms. |
![2D Structure of methyl (1R,9R,16S,18R,21R)-15-hydroxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-18-carboxylate 2D Structure of methyl (1R,9R,16S,18R,21R)-15-hydroxy-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-18-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/34aa9a80-8609-11ee-9778-8f58d284802e.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.43% | 96.09% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.08% | 83.82% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.50% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.50% | 85.14% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 90.39% | 93.03% |
CHEMBL2581 | P07339 | Cathepsin D | 89.92% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.32% | 90.00% |
CHEMBL5028 | O14672 | ADAM10 | 87.38% | 97.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.72% | 95.56% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.42% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.98% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.69% | 94.45% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.66% | 94.08% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.34% | 90.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.86% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.37% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Melodinus fusiformis |
PubChem | 101675236 |
LOTUS | LTS0171926 |
wikiData | Q104403103 |