3,4a,8,12a,12b-pentahydroxy-3-methyl-4,5,6,6a-tetrahydro-2H-benzo[a]anthracene-1,7,12-trione
| Internal ID | 67c87be1-413b-4a43-908b-bfbc268aaac1 |
| Taxonomy | Benzenoids > Anthracenes > Anthraquinones > Hydroxyanthraquinones |
| IUPAC Name | 3,4a,8,12a,12b-pentahydroxy-3-methyl-4,5,6,6a-tetrahydro-2H-benzo[a]anthracene-1,7,12-trione |
| SMILES (Canonical) | CC1(CC(=O)C2(C(C1)(CCC3C2(C(=O)C4=C(C3=O)C(=CC=C4)O)O)O)O)O |
| SMILES (Isomeric) | CC1(CC(=O)C2(C(C1)(CCC3C2(C(=O)C4=C(C3=O)C(=CC=C4)O)O)O)O)O |
| InChI | InChI=1S/C19H20O8/c1-16(24)7-12(21)19(27)17(25,8-16)6-5-10-14(22)13-9(3-2-4-11(13)20)15(23)18(10,19)26/h2-4,10,20,24-27H,5-8H2,1H3 |
| InChI Key | FZVVDODTUNGJLG-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H20O8 |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.11581759 g/mol |
| Topological Polar Surface Area (TPSA) | 152.00 Ų |
| XlogP | -1.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.28% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.93% | 91.11% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 95.71% | 82.69% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.59% | 95.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.51% | 94.75% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.43% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.73% | 96.09% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 90.01% | 93.03% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 89.16% | 91.49% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.93% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.63% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.07% | 86.33% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 83.96% | 96.00% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 83.09% | 85.11% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.65% | 92.94% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.55% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 85198912 |
| LOTUS | LTS0132812 |
| wikiData | Q105005197 |