3,4a,5-Trimethyl-4-propoxy-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-9-one
Internal ID | c6abf943-5114-463e-84f5-cc8caf9121ee |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eremophilane, 8,9-secoeremophilane and furoeremophilane sesquiterpenoids |
IUPAC Name | 3,4a,5-trimethyl-4-propoxy-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-9-one |
SMILES (Canonical) | CCCOC1C2=C(C(=O)C3=CCCC(C13C)C)OC=C2C |
SMILES (Isomeric) | CCCOC1C2=C(C(=O)C3=CCCC(C13C)C)OC=C2C |
InChI | InChI=1S/C18H24O3/c1-5-9-20-17-14-11(2)10-21-16(14)15(19)13-8-6-7-12(3)18(13,17)4/h8,10,12,17H,5-7,9H2,1-4H3 |
InChI Key | DIXBPQTYGOPNAA-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H24O3 |
Molecular Weight | 288.40 g/mol |
Exact Mass | 288.17254462 g/mol |
Topological Polar Surface Area (TPSA) | 39.40 Ų |
XlogP | 4.30 |
There are no found synonyms. |
![2D Structure of 3,4a,5-Trimethyl-4-propoxy-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-9-one 2D Structure of 3,4a,5-Trimethyl-4-propoxy-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-9-one](https://plantaedb.com/storage/docs/compounds/2023/11/34a5-trimethyl-4-propoxy-4567-tetrahydrobenzof1benzofuran-9-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 94.61% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.54% | 97.09% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 90.65% | 94.80% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.57% | 96.21% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.03% | 95.56% |
CHEMBL4072 | P07858 | Cathepsin B | 88.16% | 93.67% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.16% | 86.33% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.06% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.52% | 91.11% |
CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 84.68% | 95.34% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.14% | 100.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 83.61% | 96.38% |
CHEMBL1871 | P10275 | Androgen Receptor | 82.78% | 96.43% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.48% | 89.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.47% | 92.50% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.26% | 96.77% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.52% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Senecio conrathii |
PubChem | 162856172 |
LOTUS | LTS0128371 |
wikiData | Q104981769 |