2-[10-[5-(5-Hydroxy-6-methyloxan-2-yl)oxy-6-methyloxan-2-yl]oxy-3,5,7-trimethyl-11-(3-methyl-6-oxooxan-2-yl)dodeca-1,5,7-trienyl]-3-methyl-2,3-dihydropyran-6-one
| Internal ID | fea896d7-cf59-427b-adf5-afd678b18e81 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Diterpene glycosides |
| IUPAC Name | 2-[10-[5-(5-hydroxy-6-methyloxan-2-yl)oxy-6-methyloxan-2-yl]oxy-3,5,7-trimethyl-11-(3-methyl-6-oxooxan-2-yl)dodeca-1,5,7-trienyl]-3-methyl-2,3-dihydropyran-6-one |
| SMILES (Canonical) | CC1CCC(=O)OC1C(C)C(CC=C(C)C=C(C)CC(C)C=CC2C(C=CC(=O)O2)C)OC3CCC(C(O3)C)OC4CCC(C(O4)C)O |
| SMILES (Isomeric) | CC1CCC(=O)OC1C(C)C(CC=C(C)C=C(C)CC(C)C=CC2C(C=CC(=O)O2)C)OC3CCC(C(O3)C)OC4CCC(C(O4)C)O |
| InChI | InChI=1S/C39H60O9/c1-23(9-14-32-26(4)11-17-35(41)45-32)21-25(3)22-24(2)10-15-33(28(6)39-27(5)12-18-36(42)48-39)46-38-20-16-34(30(8)44-38)47-37-19-13-31(40)29(7)43-37/h9-11,14,17,22-23,26-34,37-40H,12-13,15-16,18-21H2,1-8H3 |
| InChI Key | QWHGIEDBQGPECB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C39H60O9 |
| Molecular Weight | 672.90 g/mol |
| Exact Mass | 672.42373349 g/mol |
| Topological Polar Surface Area (TPSA) | 110.00 Ų |
| XlogP | 8.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.32% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.53% | 98.95% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 93.39% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.76% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.99% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.44% | 95.56% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 89.51% | 93.10% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.92% | 94.73% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.73% | 97.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.53% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.23% | 89.00% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 87.28% | 89.50% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.98% | 100.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.85% | 90.71% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.57% | 96.77% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.46% | 86.33% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.03% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.02% | 97.14% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.97% | 95.89% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.15% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.85% | 94.45% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.47% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162874410 |
| LOTUS | LTS0200386 |
| wikiData | Q104196278 |