3,4,6,8-Tetrahydroxy-3,4-dihydronaphthalen-1(2H)-one
| Internal ID | 86ade786-d389-40ee-885e-fc323f4412e7 |
| Taxonomy | Benzenoids > Tetralins |
| IUPAC Name | 3,4,6,8-tetrahydroxy-3,4-dihydro-2H-naphthalen-1-one |
| SMILES (Canonical) | C1C(C(C2=C(C1=O)C(=CC(=C2)O)O)O)O |
| SMILES (Isomeric) | C1C(C(C2=C(C1=O)C(=CC(=C2)O)O)O)O |
| InChI | InChI=1S/C10H10O5/c11-4-1-5-9(6(12)2-4)7(13)3-8(14)10(5)15/h1-2,8,10-12,14-15H,3H2 |
| InChI Key | BHKWJBLOULPVEY-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05282342 g/mol |
| Topological Polar Surface Area (TPSA) | 98.00 Ų |
| XlogP | -0.20 |
| 103614-68-2 |
| DTXSID30761359 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.93% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.36% | 98.95% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 90.15% | 96.12% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.00% | 93.40% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.75% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.25% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.61% | 85.14% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.58% | 99.15% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.97% | 90.71% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 85.69% | 95.62% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.14% | 89.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.61% | 90.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.36% | 94.45% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.54% | 94.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.46% | 99.23% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.30% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 71333030 |
| LOTUS | LTS0193849 |
| wikiData | Q82716167 |