3,4,6,7-tetramethoxy-13a-methyl-11,12,13,14-tetrahydro-9H-phenanthro[9,10-f]indolizine
| Internal ID | 613a9082-57e8-4fff-86e8-31da905f5ddc |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Phenanthroindolizidines |
| IUPAC Name | 3,4,6,7-tetramethoxy-13a-methyl-11,12,13,14-tetrahydro-9H-phenanthro[9,10-f]indolizine |
| SMILES (Canonical) | CC12CCCN1CC3=C(C2)C4=C(C5=CC(=C(C=C35)OC)OC)C(=C(C=C4)OC)OC |
| SMILES (Isomeric) | CC12CCCN1CC3=C(C2)C4=C(C5=CC(=C(C=C35)OC)OC)C(=C(C=C4)OC)OC |
| InChI | InChI=1S/C25H29NO4/c1-25-9-6-10-26(25)14-19-16-11-21(28-3)22(29-4)12-17(16)23-15(18(19)13-25)7-8-20(27-2)24(23)30-5/h7-8,11-12H,6,9-10,13-14H2,1-5H3 |
| InChI Key | GPULNVYNTZGQGU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.20965841 g/mol |
| Topological Polar Surface Area (TPSA) | 40.20 Ų |
| XlogP | 4.90 |
| There are no found synonyms. |
![2D Structure of 3,4,6,7-tetramethoxy-13a-methyl-11,12,13,14-tetrahydro-9H-phenanthro[9,10-f]indolizine](https://plantaedb.com/storage/docs/compounds/2023/11/3467-tetramethoxy-13a-methyl-11121314-tetrahydro-9h-phenanthro910-findolizine.jpg "2D Structure of 3,4,6,7-tetramethoxy-13a-methyl-11,12,13,14-tetrahydro-9H-phenanthro[9,10-f]indolizine")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.73% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.75% | 96.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.08% | 93.99% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 94.03% | 92.94% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 93.47% | 89.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.16% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.72% | 98.75% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.48% | 83.82% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 90.39% | 95.12% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.00% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.69% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.46% | 95.89% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.29% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.18% | 98.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.86% | 90.00% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 85.23% | 95.53% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 84.27% | 90.20% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 84.04% | 92.38% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 84.04% | 92.98% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 83.80% | 82.38% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.01% | 89.00% |
| CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 81.71% | 92.86% |
| CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 81.70% | 98.00% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 81.37% | 94.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 15628000 |
| LOTUS | LTS0079321 |
| wikiData | Q105015194 |