3,4,5-Trimethoxyphenyl acetate
Internal ID | 87c4fd2e-66fa-4ab6-b5bc-f222be9240ee |
Taxonomy | Benzenoids > Phenol esters |
IUPAC Name | (3,4,5-trimethoxyphenyl) acetate |
SMILES (Canonical) | CC(=O)OC1=CC(=C(C(=C1)OC)OC)OC |
SMILES (Isomeric) | CC(=O)OC1=CC(=C(C(=C1)OC)OC)OC |
InChI | InChI=1S/C11H14O5/c1-7(12)16-8-5-9(13-2)11(15-4)10(6-8)14-3/h5-6H,1-4H3 |
InChI Key | ASPRESJSDRJZBN-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C11H14O5 |
Molecular Weight | 226.23 g/mol |
Exact Mass | 226.08412354 g/mol |
Topological Polar Surface Area (TPSA) | 54.00 Ų |
XlogP | 1.60 |
17742-46-0 |
(3,4,5-trimethoxyphenyl) acetate |
NSC 123859 |
NSC123859 |
SCHEMBL736176 |
DTXSID20298523 |
ASPRESJSDRJZBN-UHFFFAOYSA-N |
CHEBI:172465 |
NSC-123859 |
AC-776/41252552 |
![2D Structure of 3,4,5-Trimethoxyphenyl acetate 2D Structure of 3,4,5-Trimethoxyphenyl acetate](https://plantaedb.com/storage/docs/compounds/2023/11/345-trimethoxyphenyl-acetate.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.45% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.35% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.00% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.86% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 85.80% | 98.75% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.20% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.74% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.14% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.51% | 94.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.08% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eucalyptus globulus |
PubChem | 276280 |
LOTUS | LTS0064376 |
wikiData | Q82040375 |