[3,4,5-trihydroxy-6-[(5-oxo-2H-furan-4-yl)methoxy]oxan-2-yl]methyl 3,4-dihydroxybenzoate
| Internal ID | 8781c5be-536b-45df-8f4a-b5739d9e735f |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
| IUPAC Name | [3,4,5-trihydroxy-6-[(5-oxo-2H-furan-4-yl)methoxy]oxan-2-yl]methyl 3,4-dihydroxybenzoate |
| SMILES (Canonical) | C1C=C(C(=O)O1)COC2C(C(C(C(O2)COC(=O)C3=CC(=C(C=C3)O)O)O)O)O |
| SMILES (Isomeric) | C1C=C(C(=O)O1)COC2C(C(C(C(O2)COC(=O)C3=CC(=C(C=C3)O)O)O)O)O |
| InChI | InChI=1S/C18H20O11/c19-10-2-1-8(5-11(10)20)16(24)27-7-12-13(21)14(22)15(23)18(29-12)28-6-9-3-4-26-17(9)25/h1-3,5,12-15,18-23H,4,6-7H2 |
| InChI Key | MPWNIHQZXAKHOM-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H20O11 |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 412.10056145 g/mol |
| Topological Polar Surface Area (TPSA) | 172.00 Ų |
| XlogP | -1.30 |
| There are no found synonyms. |
![2D Structure of [3,4,5-trihydroxy-6-[(5-oxo-2H-furan-4-yl)methoxy]oxan-2-yl]methyl 3,4-dihydroxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/345-trihydroxy-6-5-oxo-2h-furan-4-ylmethoxyoxan-2-ylmethyl-34-dihydroxybenzoate.jpg "2D Structure of [3,4,5-trihydroxy-6-[(5-oxo-2H-furan-4-yl)methoxy]oxan-2-yl]methyl 3,4-dihydroxybenzoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.38% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.53% | 91.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.42% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.66% | 90.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.01% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.95% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.95% | 89.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.80% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.39% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.35% | 94.73% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 86.97% | 94.45% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.10% | 92.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.75% | 95.56% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 85.12% | 83.00% |
| CHEMBL3194 | P02766 | Transthyretin | 84.01% | 90.71% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.29% | 96.61% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 82.42% | 95.93% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.18% | 98.75% |
| CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 80.13% | 96.69% |
| CHEMBL3891 | P07384 | Calpain 1 | 80.00% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cibotium barometz |
| PubChem | 75034219 |
| LOTUS | LTS0098548 |
| wikiData | Q105169785 |