[3,4,5-Trihydroxy-6-(3-phenylprop-2-enoyloxy)oxan-2-yl]methyl 3-phenylprop-2-enoate
Internal ID | a46e5125-5ff2-4e9e-95fe-fe63509509d6 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Cinnamic acid esters > O-cinnamoyl glycosides |
IUPAC Name | [3,4,5-trihydroxy-6-(3-phenylprop-2-enoyloxy)oxan-2-yl]methyl 3-phenylprop-2-enoate |
SMILES (Canonical) | C1=CC=C(C=C1)C=CC(=O)OCC2C(C(C(C(O2)OC(=O)C=CC3=CC=CC=C3)O)O)O |
SMILES (Isomeric) | C1=CC=C(C=C1)C=CC(=O)OCC2C(C(C(C(O2)OC(=O)C=CC3=CC=CC=C3)O)O)O |
InChI | InChI=1S/C24H24O8/c25-19(13-11-16-7-3-1-4-8-16)30-15-18-21(27)22(28)23(29)24(31-18)32-20(26)14-12-17-9-5-2-6-10-17/h1-14,18,21-24,27-29H,15H2 |
InChI Key | SGNCWGPDJRRZCQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H24O8 |
Molecular Weight | 440.40 g/mol |
Exact Mass | 440.14711772 g/mol |
Topological Polar Surface Area (TPSA) | 123.00 Ų |
XlogP | 2.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.15% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.09% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.29% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.60% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.53% | 90.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.82% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.77% | 94.73% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 85.88% | 94.62% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.23% | 95.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.19% | 99.17% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 83.09% | 94.23% |
CHEMBL5028 | O14672 | ADAM10 | 81.95% | 97.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.24% | 89.00% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.88% | 94.08% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 80.58% | 83.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Corymbia maculata |
PubChem | 85251918 |
LOTUS | LTS0265053 |
wikiData | Q105252456 |