methyl (1R,5R,7R,8R,9S,12R,13S)-14-acetyl-16-hydroxy-4,9-dimethyl-10-oxa-4,14-diazapentacyclo[11.7.0.01,5.07,12.015,20]icosa-15(20),16,18-triene-8-carboxylate
Internal ID | 26ad986b-ae4b-4519-bd56-d0bc0a69d3d9 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | methyl (1R,5R,7R,8R,9S,12R,13S)-14-acetyl-16-hydroxy-4,9-dimethyl-10-oxa-4,14-diazapentacyclo[11.7.0.01,5.07,12.015,20]icosa-15(20),16,18-triene-8-carboxylate |
SMILES (Canonical) | CC1C(C2CC3C4(CCN3C)C(C2CO1)N(C5=C4C=CC=C5O)C(=O)C)C(=O)OC |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@@H]2C[C@@H]3[C@]4(CCN3C)[C@H]([C@@H]2CO1)N(C5=C4C=CC=C5O)C(=O)C)C(=O)OC |
InChI | InChI=1S/C23H30N2O5/c1-12-19(22(28)29-4)14-10-18-23(8-9-24(18)3)16-6-5-7-17(27)20(16)25(13(2)26)21(23)15(14)11-30-12/h5-7,12,14-15,18-19,21,27H,8-11H2,1-4H3/t12-,14+,15+,18+,19-,21-,23+/m0/s1 |
InChI Key | ZQPCCJJZXCRROO-OECZLWBVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H30N2O5 |
Molecular Weight | 414.50 g/mol |
Exact Mass | 414.21547206 g/mol |
Topological Polar Surface Area (TPSA) | 79.30 Ų |
XlogP | 1.60 |
There are no found synonyms. |
![2D Structure of methyl (1R,5R,7R,8R,9S,12R,13S)-14-acetyl-16-hydroxy-4,9-dimethyl-10-oxa-4,14-diazapentacyclo[11.7.0.01,5.07,12.015,20]icosa-15(20),16,18-triene-8-carboxylate 2D Structure of methyl (1R,5R,7R,8R,9S,12R,13S)-14-acetyl-16-hydroxy-4,9-dimethyl-10-oxa-4,14-diazapentacyclo[11.7.0.01,5.07,12.015,20]icosa-15(20),16,18-triene-8-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/342a55b0-8282-11ee-b916-dd2ee50913dd.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.31% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.67% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.87% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.00% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.20% | 86.33% |
CHEMBL238 | Q01959 | Dopamine transporter | 86.52% | 95.88% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.74% | 90.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.25% | 91.19% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 84.23% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.14% | 89.00% |
CHEMBL5028 | O14672 | ADAM10 | 82.76% | 97.50% |
CHEMBL2581 | P07339 | Cathepsin D | 82.63% | 98.95% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.20% | 94.42% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.04% | 94.00% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 80.67% | 96.39% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Strychnos myrtoides |
PubChem | 15286685 |
LOTUS | LTS0230364 |
wikiData | Q105381622 |