[2-[2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-4-hydroxy-5-[3-(4-hydroxyphenyl)prop-2-enoyloxy]-6-methyloxan-3-yl] 4-hydroxybenzoate
Internal ID | 4a4e4291-a02e-4add-a53f-3da5c2204be1 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | [2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-4-hydroxy-5-[3-(4-hydroxyphenyl)prop-2-enoyloxy]-6-methyloxan-3-yl] 4-hydroxybenzoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C=C4)O)O)OC(=O)C5=CC=C(C=C5)O)O)OC(=O)C=CC6=CC=C(C=C6)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C=C4)O)O)OC(=O)C5=CC=C(C=C5)O)O)OC(=O)C=CC6=CC=C(C=C6)O |
InChI | InChI=1S/C37H30O15/c1-17-32(50-28(44)13-4-18-2-8-21(38)9-3-18)31(46)35(51-36(47)19-5-10-22(39)11-6-19)37(48-17)52-34-30(45)29-26(43)15-23(40)16-27(29)49-33(34)20-7-12-24(41)25(42)14-20/h2-17,31-32,35,37-43,46H,1H3 |
InChI Key | VJZCKTQRIDJDHL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C37H30O15 |
Molecular Weight | 714.60 g/mol |
Exact Mass | 714.15847025 g/mol |
Topological Polar Surface Area (TPSA) | 239.00 Ų |
XlogP | 5.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.87% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 99.19% | 89.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.07% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.82% | 86.33% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 98.36% | 95.64% |
CHEMBL3194 | P02766 | Transthyretin | 97.91% | 90.71% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 96.31% | 80.78% |
CHEMBL2581 | P07339 | Cathepsin D | 96.27% | 98.95% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.66% | 93.99% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 95.18% | 98.35% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.81% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.18% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.04% | 95.56% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 88.84% | 95.78% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.63% | 94.73% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 87.39% | 83.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.99% | 99.23% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 86.70% | 97.31% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.55% | 96.00% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 85.18% | 85.31% |
CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 85.17% | 88.00% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 84.32% | 96.00% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 83.21% | 87.67% |
CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 83.15% | 97.53% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.69% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.45% | 97.09% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 81.32% | 81.11% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.77% | 95.50% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.76% | 91.19% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.59% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Libocedrus bidwillii |
PubChem | 74978209 |
LOTUS | LTS0078955 |
wikiData | Q105287615 |