3,4-Dimethoxy-[1,3]benzodioxolo[5,6-c]phenanthridine
| Internal ID | 3f2335b9-fb63-4b3b-a164-cecac646e8a9 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Phenanthridines and derivatives |
| IUPAC Name | 3,4-dimethoxy-[1,3]benzodioxolo[5,6-c]phenanthridine |
| SMILES (Canonical) | COC1=C(C2=C3C=CC4=CC5=C(C=C4C3=NC=C2C=C1)OCO5)OC |
| SMILES (Isomeric) | COC1=C(C2=C3C=CC4=CC5=C(C=C4C3=NC=C2C=C1)OCO5)OC |
| InChI | InChI=1S/C20H15NO4/c1-22-15-6-4-12-9-21-19-13(18(12)20(15)23-2)5-3-11-7-16-17(8-14(11)19)25-10-24-16/h3-9H,10H2,1-2H3 |
| InChI Key | GGOQNPMQWNXDQK-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H15NO4 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.10010796 g/mol |
| Topological Polar Surface Area (TPSA) | 49.80 Ų |
| XlogP | 4.40 |
| There are no found synonyms. |
![2D Structure of 3,4-Dimethoxy-[1,3]benzodioxolo[5,6-c]phenanthridine](https://plantaedb.com/storage/docs/compounds/2023/11/34-dimethoxy-13benzodioxolo56-cphenanthridine.jpg "2D Structure of 3,4-Dimethoxy-[1,3]benzodioxolo[5,6-c]phenanthridine")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.87% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.03% | 94.45% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 93.03% | 96.77% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.91% | 98.75% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 92.40% | 92.62% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 92.32% | 92.51% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.23% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.34% | 96.00% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 91.11% | 95.12% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.74% | 89.62% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.64% | 83.82% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.58% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 88.53% | 91.49% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.54% | 95.78% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.52% | 96.09% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 84.46% | 80.96% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.33% | 99.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.27% | 95.89% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 82.38% | 94.03% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.24% | 95.56% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.06% | 94.80% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 81.63% | 92.38% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.53% | 89.00% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 80.31% | 85.49% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 80.27% | 92.50% |
| CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 80.16% | 85.00% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 80.13% | 82.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Argemone mexicana |
| PubChem | 101497140 |
| LOTUS | LTS0243204 |
| wikiData | Q105008252 |