3,4-Dihydroxyxanthone
| Internal ID | c7072c6e-bbb4-4151-8522-8a1014dbba9a |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | 3,4-dihydroxyxanthen-9-one |
| SMILES (Canonical) | C1=CC=C2C(=C1)C(=O)C3=C(O2)C(=C(C=C3)O)O |
| SMILES (Isomeric) | C1=CC=C2C(=C1)C(=O)C3=C(O2)C(=C(C=C3)O)O |
| InChI | InChI=1S/C13H8O4/c14-9-6-5-8-11(15)7-3-1-2-4-10(7)17-13(8)12(9)16/h1-6,14,16H |
| InChI Key | YFVCSEXMOBEPQB-UHFFFAOYSA-N |
| Popularity | 14 references in papers |
| Molecular Formula | C13H8O4 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.04225873 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 2.30 |
| 3,4-Dihydroxy-xanthone |
| 39731-48-1 |
| CHEMBL446323 |
| 9H-Xanthen-9-one, 3,4-dihydroxy- |
| 3,4-dihydroxyxanthen-9-one |
| SCHEMBL133422 |
| 3,4-dihydroxy-xanthen-9-one |
| DTXSID20192815 |
| YFVCSEXMOBEPQB-UHFFFAOYSA-N |
| 3,4-dihydroxy-9H-xanthen-9-one |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.66% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.38% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.95% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.06% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.68% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.79% | 94.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.72% | 99.15% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 83.49% | 98.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.37% | 94.73% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.47% | 93.65% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.85% | 94.62% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.13% | 80.78% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 80.02% | 94.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Calophyllum membranaceum |
| PubChem | 5748382 |
| LOTUS | LTS0217805 |
| wikiData | Q83065474 |