3,4-Dihydroxy-5-methoxy-2,2-dimethyl-3,4-dihydropyrano[3,2-g]chromen-8-one
| Internal ID | 940e4617-f26d-4b86-9762-ad14eefd51cf |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Pyranocoumarins > Linear pyranocoumarins |
| IUPAC Name | 3,4-dihydroxy-5-methoxy-2,2-dimethyl-3,4-dihydropyrano[3,2-g]chromen-8-one |
| SMILES (Canonical) | CC1(C(C(C2=C(O1)C=C3C(=C2OC)C=CC(=O)O3)O)O)C |
| SMILES (Isomeric) | CC1(C(C(C2=C(O1)C=C3C(=C2OC)C=CC(=O)O3)O)O)C |
| InChI | InChI=1S/C15H16O6/c1-15(2)14(18)12(17)11-9(21-15)6-8-7(13(11)19-3)4-5-10(16)20-8/h4-6,12,14,17-18H,1-3H3 |
| InChI Key | WZJQHBPPISFUSP-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.09468823 g/mol |
| Topological Polar Surface Area (TPSA) | 85.20 Ų |
| XlogP | 0.80 |
| There are no found synonyms. |
![2D Structure of 3,4-Dihydroxy-5-methoxy-2,2-dimethyl-3,4-dihydropyrano[3,2-g]chromen-8-one](https://plantaedb.com/storage/docs/compounds/2023/11/34-dihydroxy-5-methoxy-22-dimethyl-34-dihydropyrano32-gchromen-8-one.jpg "2D Structure of 3,4-Dihydroxy-5-methoxy-2,2-dimethyl-3,4-dihydropyrano[3,2-g]chromen-8-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.96% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.68% | 94.45% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.33% | 83.82% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.12% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.39% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.71% | 98.95% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 89.55% | 94.03% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.13% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.20% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.62% | 99.23% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.86% | 92.62% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.45% | 96.09% |
| CHEMBL1871 | P10275 | Androgen Receptor | 83.28% | 96.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Citrus × aurantium |
| PubChem | 163024792 |
| LOTUS | LTS0100780 |
| wikiData | Q105323249 |