3,4-Dihydroxy-4',5-dimethoxybibenzyl
| Internal ID | 80d5b842-7a54-4da6-b841-f3960560211b |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 3-methoxy-5-[2-(4-methoxyphenyl)ethyl]benzene-1,2-diol |
| SMILES (Canonical) | COC1=CC=C(C=C1)CCC2=CC(=C(C(=C2)OC)O)O |
| SMILES (Isomeric) | COC1=CC=C(C=C1)CCC2=CC(=C(C(=C2)OC)O)O |
| InChI | InChI=1S/C16H18O4/c1-19-13-7-5-11(6-8-13)3-4-12-9-14(17)16(18)15(10-12)20-2/h5-10,17-18H,3-4H2,1-2H3 |
| InChI Key | QUSGGAWWVBQNLE-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.12050905 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 3.40 |
| 3,4-dihydroxy-4',5-dimethoxybibenzyl |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.64% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.32% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.33% | 90.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.39% | 94.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.86% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.55% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.85% | 98.95% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.46% | 92.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.47% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.16% | 99.15% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 86.99% | 90.24% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.50% | 86.92% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.20% | 95.89% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.12% | 98.75% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 83.99% | 92.68% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.40% | 96.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.76% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.46% | 94.45% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.84% | 95.50% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 81.18% | 95.17% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 80.52% | 96.09% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.41% | 93.18% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.31% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dendrobium moniliforme |
| PubChem | 21575213 |
| LOTUS | LTS0198130 |
| wikiData | Q105228398 |