3,4-Dihydroxy-2-nitrobenzophenone
| Internal ID | e8805aa8-a036-4f83-8a74-da8138601ea1 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzophenones |
| IUPAC Name | (3,4-dihydroxy-2-nitrophenyl)-phenylmethanone |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H9NO5/c15-10-7-6-9(11(13(10)17)14(18)19)12(16)8-4-2-1-3-5-8/h1-7,15,17H |
| InChI Key | ICLKAUQIPVFHOI-UHFFFAOYSA-N |
| Popularity | 8 references in papers |
| Molecular Formula | C13H9NO5 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.04807239 g/mol |
| Topological Polar Surface Area (TPSA) | 103.00 Ų |
| XlogP | 2.90 |
| (3,4-dihydroxy-2-nitrophenyl)-phenylmethanone |
| SCHEMBL5898857 |
| ICLKAUQIPVFHOI-UHFFFAOYSA-N |
| 3,4-dihydroxy-2-nitrobenzophenone |
| DB07462 |
| PD005163 |
| (3,4-dihydroxy-2-nitrophenyl)phenylmethanone |
| Q27096682 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.28% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.70% | 95.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.89% | 90.17% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 87.88% | 93.81% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 87.31% | 90.20% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.05% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.41% | 91.11% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.14% | 99.23% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.01% | 94.62% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 82.72% | 89.23% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.68% | 98.75% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.22% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 6914595 |
| LOTUS | LTS0203661 |
| wikiData | Q27096682 |