3,4-Dihydro-5,7-dihydroxy-4-(4-hydroxyphenyl)coumarin
| Internal ID | e75927ec-44fd-48e1-9674-27f46567306e |
| Taxonomy | Phenylpropanoids and polyketides > Neoflavonoids > Neoflavans |
| IUPAC Name | 5,7-dihydroxy-4-(4-hydroxyphenyl)-3,4-dihydrochromen-2-one |
| SMILES (Canonical) | C1C(C2=C(C=C(C=C2OC1=O)O)O)C3=CC=C(C=C3)O |
| SMILES (Isomeric) | C1C(C2=C(C=C(C=C2OC1=O)O)O)C3=CC=C(C=C3)O |
| InChI | InChI=1S/C15H12O5/c16-9-3-1-8(2-4-9)11-7-14(19)20-13-6-10(17)5-12(18)15(11)13/h1-6,11,16-18H,7H2 |
| InChI Key | YFBYVGLTPVOMJI-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.06847348 g/mol |
| Topological Polar Surface Area (TPSA) | 87.00 Ų |
| XlogP | 2.00 |
| SCHEMBL14781369 |
| BDBM50539412 |
| 3,4-dihydro-5,7-dihydroxy-4-(4-hydroxyphenyl)coumarin |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.73% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 94.91% | 83.82% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.27% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.02% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.56% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.99% | 89.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.64% | 96.09% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.35% | 93.40% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.06% | 99.23% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 84.08% | 85.11% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.97% | 90.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.39% | 94.45% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.23% | 90.00% |
| CHEMBL3194 | P02766 | Transthyretin | 81.80% | 90.71% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.75% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 13803350 |
| LOTUS | LTS0128521 |
| wikiData | Q105347505 |