3,4-Dihydro-3-(2-hydroxy-3,4-dimethoxyphenyl)-2H-1-benzopyran-7-yl beta-D-glucopyranoside
Internal ID | c9c9a60b-fdb3-4cc3-a6cf-97818ad3b102 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavonoid O-glycosides |
IUPAC Name | 2-[[3-(2-hydroxy-3,4-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | COC1=C(C(=C(C=C1)C2CC3=C(C=C(C=C3)OC4C(C(C(C(O4)CO)O)O)O)OC2)O)OC |
SMILES (Isomeric) | COC1=C(C(=C(C=C1)C2CC3=C(C=C(C=C3)OC4C(C(C(C(O4)CO)O)O)O)OC2)O)OC |
InChI | InChI=1S/C23H28O10/c1-29-15-6-5-14(18(25)22(15)30-2)12-7-11-3-4-13(8-16(11)31-10-12)32-23-21(28)20(27)19(26)17(9-24)33-23/h3-6,8,12,17,19-21,23-28H,7,9-10H2,1-2H3 |
InChI Key | SXHOGLPTLQBGDO-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C23H28O10 |
Molecular Weight | 464.50 g/mol |
Exact Mass | 464.16824709 g/mol |
Topological Polar Surface Area (TPSA) | 147.00 Ų |
XlogP | 1.10 |
3,4-Dihydro-3-(2-hydroxy-3,4-dimethoxyphenyl)-2H-1-benzopyran-7-yl beta-D-glucopyranoside |
AKOS037514949 |
FT-0776602 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.04% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.27% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 94.90% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.49% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.44% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.30% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.10% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.43% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 88.65% | 98.95% |
CHEMBL220 | P22303 | Acetylcholinesterase | 87.90% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.87% | 96.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.20% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.17% | 90.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.15% | 92.62% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.86% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.33% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.24% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.10% | 99.15% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.69% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Astragalus mongholicus |
PubChem | 53461957 |
LOTUS | LTS0217038 |
wikiData | Q105263118 |