(2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5R,6R)-3-hydroxy-2-(hydroxymethyl)-6-[(1R,2S,4S,5'R,6R,7S,8S,9S,12S,13R,16S)-8-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]oxy-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-4-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | ab307de1-aeff-4b52-9c2a-f7dc737e521e |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5R,6R)-3-hydroxy-2-(hydroxymethyl)-6-[(1R,2S,4S,5'R,6R,7S,8S,9S,12S,13R,16S)-8-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]oxy-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-4-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1CCC2(C(C3(C(O2)CC4C3(CCC5C4CC=C6C5(CCC(C6)OC7C(C(C(C(O7)CO)O)OC8C(C(C(C(O8)C)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)O)C)OC1 |
SMILES (Isomeric) | C[C@@H]1CC[C@@]2([C@H]([C@]3([C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5(CC[C@@H](C6)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O)O)O)O[C@H]9[C@@H]([C@@H]([C@H]([C@@H](O9)C)O)O)O)C)C)O)C)OC1 |
InChI | InChI=1S/C45H72O17/c1-19-9-14-44(55-18-19)22(4)45(54)29(62-44)16-27-25-8-7-23-15-24(10-12-42(23,5)26(25)11-13-43(27,45)6)58-41-38(61-40-36(53)34(51)31(48)21(3)57-40)37(32(49)28(17-46)59-41)60-39-35(52)33(50)30(47)20(2)56-39/h7,19-22,24-41,46-54H,8-18H2,1-6H3/t19-,20+,21+,22-,24+,25-,26+,27+,28-,29+,30+,31+,32-,33-,34-,35-,36-,37+,38-,39+,40+,41-,42+,43+,44-,45-/m1/s1 |
InChI Key | NLMRPYJFEJTQEC-JQHDQEQCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C45H72O17 |
Molecular Weight | 885.00 g/mol |
Exact Mass | 884.47695082 g/mol |
Topological Polar Surface Area (TPSA) | 256.00 Ų |
XlogP | 0.60 |
There are no found synonyms. |
![2D Structure of (2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5R,6R)-3-hydroxy-2-(hydroxymethyl)-6-[(1R,2S,4S,5'R,6R,7S,8S,9S,12S,13R,16S)-8-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]oxy-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-4-yl]oxy-6-methyloxane-3,4,5-triol 2D Structure of (2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5R,6R)-3-hydroxy-2-(hydroxymethyl)-6-[(1R,2S,4S,5'R,6R,7S,8S,9S,12S,13R,16S)-8-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]oxy-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-4-yl]oxy-6-methyloxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/33e5eb90-84a0-11ee-b509-01eff3261430.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.48% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.25% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.41% | 95.93% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.31% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.02% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.85% | 100.00% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 89.19% | 97.53% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.92% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.34% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.76% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.19% | 94.45% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 86.80% | 95.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.35% | 94.75% |
CHEMBL2581 | P07339 | Cathepsin D | 86.24% | 98.95% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.00% | 91.71% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.87% | 92.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.68% | 95.89% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 85.45% | 94.08% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 84.80% | 94.23% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 84.77% | 96.61% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.77% | 91.49% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.48% | 95.50% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.01% | 86.92% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 82.40% | 89.05% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.13% | 93.56% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.82% | 96.95% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.74% | 97.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.69% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dioscorea bulbifera |
Dracaena arborea |
PubChem | 46186821 |
LOTUS | LTS0173561 |
wikiData | Q105181453 |