(1R,6S,11R,12S,15S)-11-hydroxy-6,12,16-trimethyl-2-methylidenetricyclo[7.5.2.012,15]hexadec-9(16)-en-10-one
| Internal ID | d2bde3f5-afa4-4645-8896-63edfac47333 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | (1R,6S,11R,12S,15S)-11-hydroxy-6,12,16-trimethyl-2-methylidenetricyclo[7.5.2.012,15]hexadec-9(16)-en-10-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C20H30O2/c1-12-6-5-7-13(2)15-10-11-20(4)17(15)14(3)16(9-8-12)18(21)19(20)22/h12,15,17,19,22H,2,5-11H2,1,3-4H3/t12-,15-,17+,19-,20-/m0/s1 |
| InChI Key | VXHXPUWLVSAWNZ-SGAUTPTISA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.224580195 g/mol |
| Topological Polar Surface Area (TPSA) | 37.30 Ų |
| XlogP | 4.30 |
| There are no found synonyms. |
![2D Structure of (1R,6S,11R,12S,15S)-11-hydroxy-6,12,16-trimethyl-2-methylidenetricyclo[7.5.2.012,15]hexadec-9(16)-en-10-one](https://plantaedb.com/storage/docs/compounds/2023/11/33e2cf40-87e2-11ee-8661-d142186aae08.jpg "2D Structure of (1R,6S,11R,12S,15S)-11-hydroxy-6,12,16-trimethyl-2-methylidenetricyclo[7.5.2.012,15]hexadec-9(16)-en-10-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.44% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.60% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.46% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.54% | 98.95% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 89.58% | 96.38% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.24% | 90.71% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 88.40% | 95.92% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.86% | 94.75% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.31% | 100.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.29% | 92.94% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 83.80% | 90.93% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 83.38% | 98.10% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.62% | 97.09% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.54% | 93.04% |
| CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 82.26% | 99.29% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.54% | 95.89% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.48% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.17% | 89.00% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.48% | 90.08% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 80.36% | 97.64% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.06% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163036768 |
| LOTUS | LTS0089488 |
| wikiData | Q105298513 |