[(E)-3-[(2R,3S)-3-(acetyloxymethyl)-2,3-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-8-methoxy-4H-chromen-6-yl]prop-2-enyl] acetate
| Internal ID | 47d41dc1-b12e-4525-b6bc-62f90f79e7c9 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 8-O-methylated flavonoids |
| IUPAC Name | [(E)-3-[(2R,3S)-3-(acetyloxymethyl)-2,3-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-8-methoxy-4H-chromen-6-yl]prop-2-enyl] acetate |
| SMILES (Canonical) | CC(=O)OCC=CC1=CC2=C(C(=C1)OC)OC(C(C2)(COC(=O)C)O)(C3=CC(=C(C=C3)O)OC)O |
| SMILES (Isomeric) | CC(=O)OC/C=C/C1=CC2=C(C(=C1)OC)O[C@@]([C@](C2)(COC(=O)C)O)(C3=CC(=C(C=C3)O)OC)O |
| InChI | InChI=1S/C25H28O10/c1-15(26)33-9-5-6-17-10-18-13-24(29,14-34-16(2)27)25(30,35-23(18)22(11-17)32-4)19-7-8-20(28)21(12-19)31-3/h5-8,10-12,28-30H,9,13-14H2,1-4H3/b6-5+/t24-,25+/m0/s1 |
| InChI Key | ZOOQSYSDJPCTCO-BUMFPCDBSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C25H28O10 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.16824709 g/mol |
| Topological Polar Surface Area (TPSA) | 141.00 Ų |
| XlogP | 1.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.61% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.31% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.88% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.84% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.65% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.15% | 90.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.88% | 89.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.81% | 94.45% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 84.90% | 91.49% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.74% | 99.17% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.94% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163193888 |
| LOTUS | LTS0073496 |
| wikiData | Q105380622 |