[(1R,4aR,4bS,7R,10aR)-7-ethenyl-1,4a,7-trimethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl acetate
Internal ID | 70d27a77-a24c-4050-b95f-9e56c575a158 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | [(1R,4aR,4bS,7R,10aR)-7-ethenyl-1,4a,7-trimethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-1-yl]methyl acetate |
SMILES (Canonical) | CC(=O)OCC1(CCCC2(C1CCC3=CC(CCC32)(C)C=C)C)C |
SMILES (Isomeric) | CC(=O)OC[C@@]1(CCC[C@]2([C@H]1CCC3=C[C@@](CC[C@@H]32)(C)C=C)C)C |
InChI | InChI=1S/C22H34O2/c1-6-20(3)13-10-18-17(14-20)8-9-19-21(4,15-24-16(2)23)11-7-12-22(18,19)5/h6,14,18-19H,1,7-13,15H2,2-5H3/t18-,19-,20-,21-,22+/m0/s1 |
InChI Key | YAEKQWMHIISSGS-KNOXWWKRSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H34O2 |
Molecular Weight | 330.50 g/mol |
Exact Mass | 330.255880323 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 6.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.14% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.86% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.68% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.23% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.69% | 95.89% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.43% | 82.69% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.11% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.93% | 97.09% |
CHEMBL5028 | O14672 | ADAM10 | 83.36% | 97.50% |
CHEMBL2581 | P07339 | Cathepsin D | 82.72% | 98.95% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.02% | 100.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.97% | 95.50% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.70% | 94.33% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.42% | 94.00% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 81.07% | 96.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.67% | 92.62% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.29% | 100.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.27% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cryptomeria japonica |
PubChem | 14264137 |
LOTUS | LTS0072527 |
wikiData | Q105345353 |