3-hydroxy-7-methoxy-3-[(4-methoxyphenyl)methyl]-5-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxy-2H-chromen-4-one
| Internal ID | 141101cd-0271-47bb-9c07-c934deac6997 |
| Taxonomy | Phenylpropanoids and polyketides > Homoisoflavonoids > Homoisoflavans |
| IUPAC Name | 3-hydroxy-7-methoxy-3-[(4-methoxyphenyl)methyl]-5-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxy-2H-chromen-4-one |
| SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=CC4=C3C(=O)C(CO4)(CC5=CC=C(C=C5)OC)O)OC)O)O)O)O)O)O |
| SMILES (Isomeric) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=CC4=C3C(=O)C(CO4)(CC5=CC=C(C=C5)OC)O)OC)O)O)O)O)O)O |
| InChI | InChI=1S/C30H38O15/c1-13-21(31)23(33)25(35)28(43-13)41-11-19-22(32)24(34)26(36)29(45-19)44-18-9-16(40-3)8-17-20(18)27(37)30(38,12-42-17)10-14-4-6-15(39-2)7-5-14/h4-9,13,19,21-26,28-29,31-36,38H,10-12H2,1-3H3 |
| InChI Key | KSHJZZNTIIWCHH-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H38O15 |
| Molecular Weight | 638.60 g/mol |
| Exact Mass | 638.22107050 g/mol |
| Topological Polar Surface Area (TPSA) | 223.00 Ų |
| XlogP | -1.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.36% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.81% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.92% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.86% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.73% | 86.33% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 94.37% | 96.77% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.48% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.79% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.09% | 97.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 91.31% | 90.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.16% | 94.45% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.35% | 95.89% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 88.76% | 96.61% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.40% | 97.36% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 88.30% | 95.93% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.99% | 92.62% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.91% | 85.14% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.45% | 96.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.00% | 89.00% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 85.63% | 94.80% |
| CHEMBL5957 | P21589 | 5'-nucleotidase | 82.55% | 97.78% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.13% | 97.14% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.03% | 86.92% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.97% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Albuca bracteata |
| PubChem | 73093544 |
| LOTUS | LTS0133492 |
| wikiData | Q105145410 |