(2S,3S,4S,5R,6R)-6-[[(2S,3R,4aR,6aR,6bS,8aR,11S,12aS,14aR,14bR)-8a-carboxy-2-hydroxy-4,4,6a,6b,11,14b-hexamethyl-11-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4-dihydroxy-5-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxane-2-carboxylic acid
| Internal ID | 3f2d40f2-76d0-4e9b-85dc-72049725f791 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
| IUPAC Name | (2S,3S,4S,5R,6R)-6-[[(2S,3R,4aR,6aR,6bS,8aR,11S,12aS,14aR,14bR)-8a-carboxy-2-hydroxy-4,4,6a,6b,11,14b-hexamethyl-11-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4-dihydroxy-5-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxane-2-carboxylic acid |
| SMILES (Canonical) | CC1(C2CCC3(C(C2(CC(C1OC4C(C(C(C(O4)C(=O)O)O)O)OC5C(C(C(CO5)O)O)O)O)C)CC=C6C3(CCC7(C6CC(CC7)(C)COC8C(C(C(C(O8)CO)O)O)O)C(=O)O)C)C)C |
| SMILES (Isomeric) | C[C@@]1(CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(C[C@@H]([C@@H](C5(C)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)C(=O)O)O)O)O[C@H]7[C@@H]([C@H]([C@H](CO7)O)O)O)O)C)C)[C@@H]2C1)C)C(=O)O)CO[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O |
| InChI | InChI=1S/C47H74O20/c1-42(2)25-9-10-46(6)26(44(25,4)16-22(49)36(42)67-40-35(31(55)30(54)34(65-40)37(58)59)66-38-32(56)27(51)23(50)18-62-38)8-7-20-21-15-43(3,11-13-47(21,41(60)61)14-12-45(20,46)5)19-63-39-33(57)29(53)28(52)24(17-48)64-39/h7,21-36,38-40,48-57H,8-19H2,1-6H3,(H,58,59)(H,60,61)/t21-,22-,23-,24+,25-,26+,27-,28+,29-,30-,31-,32+,33+,34-,35+,36-,38-,39+,40-,43-,44-,45+,46+,47-/m0/s1 |
| InChI Key | QDOFAPBFPIJASR-IIZBISTBSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C47H74O20 |
| Molecular Weight | 959.10 g/mol |
| Exact Mass | 958.47734475 g/mol |
| Topological Polar Surface Area (TPSA) | 332.00 Ų |
| XlogP | 0.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.84% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.14% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.46% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.08% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.33% | 97.09% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.96% | 97.36% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.69% | 95.50% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.89% | 98.95% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.62% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.51% | 86.33% |
| CHEMBL5028 | O14672 | ADAM10 | 84.50% | 97.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.65% | 95.89% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.54% | 94.33% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.43% | 91.24% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.30% | 91.07% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.06% | 92.50% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.61% | 97.25% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.98% | 93.00% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.65% | 96.77% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.27% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Medicago arabica |
| PubChem | 163008044 |
| LOTUS | LTS0081048 |
| wikiData | Q105218899 |